EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H33N7O2.CH4O3S |
| Net Charge | 0 |
| Average Mass | 595.726 |
| Monoisotopic Mass | 595.25769 |
| SMILES | C=CC(=O)Nc1cc(Nc2nccc(-c3cn(C)c4ccccc34)n2)c(OC)cc1N(C)CCN(C)C.CS(=O)(=O)O |
| InChI | InChI=1S/C28H33N7O2.CH4O3S/c1-7-27(36)30-22-16-23(26(37-6)17-25(22)34(4)15-14-33(2)3)32-28-29-13-12-21(31-28)20-18-35(5)24-11-9-8-10-19(20)24;1-5(2,3)4/h7-13,16-18H,1,14-15H2,2-6H3,(H,30,36)(H,29,31,32);1H3,(H,2,3,4) |
| InChIKey | FUKSNUHSJBTCFJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | epidermal growth factor receptor antagonist An antagonist at the epidermal growth factor receptor. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| osimertinib mesylate (CHEBI:90948) has part osimertinib(1+) (CHEBI:90949) |
| osimertinib mesylate (CHEBI:90948) has role antineoplastic agent (CHEBI:35610) |
| osimertinib mesylate (CHEBI:90948) has role epidermal growth factor receptor antagonist (CHEBI:74440) |
| osimertinib mesylate (CHEBI:90948) is a methanesulfonate salt (CHEBI:38037) |
| IUPAC Name |
|---|
| N-(2-{[2-(dimethylamino)ethyl](methyl)amino}-4-methoxy-5-{[4-(1-methyl-1H-indol-3-yl)pyrimidin-2-yl]amino}phenyl)prop-2-enamide methanesulfonate |
| Synonyms | Source |
|---|---|
| AZD9291 mesylate | DrugCentral |
| osimertinib mesilate | DrugCentral |
| osimertinib mesylate | DrugCentral |
| osimertinib methanesulfonate | ChEBI |
| osimertinib monomesylate | ChEBI |
| Brand Name | Source |
|---|---|
| Tagrisso | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| D10766 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23334374 | Reaxys |
| CAS:1421373-66-1 | ChemIDplus |
| Citations |
|---|