EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H33N3O7 |
| Net Charge | 0 |
| Average Mass | 475.542 |
| Monoisotopic Mass | 475.23185 |
| SMILES | [H][C@@]12CC(/C=C/C)=CN1C(=O)c1cc(O[C@@H]3O[C@@H](C)[C@H](NC)[C@@](C)(O)[C@H]3O)c(C)c(O)c1N[C@@H]2O |
| InChI | InChI=1S/C24H33N3O7/c1-6-7-13-8-15-21(30)26-17-14(22(31)27(15)10-13)9-16(11(2)18(17)28)34-23-20(29)24(4,32)19(25-5)12(3)33-23/h6-7,9-10,12,15,19-21,23,25-26,28-30,32H,8H2,1-5H3/b7-6+/t12-,15-,19-,20-,21+,23-,24+/m0/s1 |
| InChIKey | RAGFPHFDFVNLCG-INYQBOQCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptosporangium sibiricum (ncbitaxon:457432) | - | PubMed (25960001) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sibiromycin (CHEBI:90941) has role antineoplastic agent (CHEBI:35610) |
| sibiromycin (CHEBI:90941) has role bacterial metabolite (CHEBI:76969) |
| sibiromycin (CHEBI:90941) is a aminoglycoside antibiotic (CHEBI:22507) |
| sibiromycin (CHEBI:90941) is a hemiaminal (CHEBI:73080) |
| sibiromycin (CHEBI:90941) is a phenols (CHEBI:33853) |
| sibiromycin (CHEBI:90941) is a pyrrolobenzodiazepine (CHEBI:131437) |
| IUPAC Name |
|---|
| (11R,11aS)-9,11-dihydroxy-8-methyl-5-oxo-2-[(1E)-prop-1-en-1-yl]-5,10,11,11a-tetrahydro-1H-pyrrolo[2,1-][1,4]benzodiazepin-7-yl 4,6-dideoxy-3-C-methyl-4-(methylamino)-α-L-mannopyranoside |
| Synonym | Source |
|---|---|
| Sybiromycin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14751112 | Reaxys |
| CAS:12684-33-2 | KNApSAcK |
| CAS:12684-33-2 | ChemIDplus |
| Citations |
|---|