EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H32Cl2N4O |
| Net Charge | 0 |
| Average Mass | 427.420 |
| Monoisotopic Mass | 426.19532 |
| SMILES | CN(C)C(=O)N[C@H]1CC[C@H](CCN2CCN(c3cccc(Cl)c3Cl)CC2)CC1 |
| InChI | InChI=1S/C21H32Cl2N4O/c1-25(2)21(28)24-17-8-6-16(7-9-17)10-11-26-12-14-27(15-13-26)19-5-3-4-18(22)20(19)23/h3-5,16-17H,6-15H2,1-2H3,(H,24,28)/t16-,17- |
| InChIKey | KPWSJANDNDDRMB-QAQDUYKDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. dopamine agonist A drug that binds to and activates dopamine receptors. |
| Applications: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. dopamine agonist A drug that binds to and activates dopamine receptors. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. second generation antipsychotic Antipsychotic drugs which can have different modes of action but which tend to be less likely than first generation antipsychotics to cause extrapyramidal motor control disabilities such as body rigidity or Parkinson's disease-type movements. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cariprazine (CHEBI:90933) has role antidepressant (CHEBI:35469) |
| cariprazine (CHEBI:90933) has role antipsychotic agent (CHEBI:35476) |
| cariprazine (CHEBI:90933) has role anxiolytic drug (CHEBI:35474) |
| cariprazine (CHEBI:90933) has role dopamine agonist (CHEBI:51065) |
| cariprazine (CHEBI:90933) has role second generation antipsychotic (CHEBI:65191) |
| cariprazine (CHEBI:90933) has role serotonergic antagonist (CHEBI:48279) |
| cariprazine (CHEBI:90933) is a N-alkylpiperazine (CHEBI:46845) |
| cariprazine (CHEBI:90933) is a N-arylpiperazine (CHEBI:46848) |
| cariprazine (CHEBI:90933) is a dichlorobenzene (CHEBI:23697) |
| cariprazine (CHEBI:90933) is a ureas (CHEBI:47857) |
| cariprazine (CHEBI:90933) is conjugate base of cariprazine(1+) (CHEBI:90934) |
| Incoming Relation(s) |
| cariprazine(1+) (CHEBI:90934) is conjugate acid of cariprazine (CHEBI:90933) |
| IUPAC Name |
|---|
| N'-(trans-4-{2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl}cyclohexyl)-N,N-dimethylurea |
| INNs | Source |
|---|---|
| cariprazina | WHO MedNet |
| cariprazine | KEGG DRUG |
| Synonyms | Source |
|---|---|
| Fri-7000188 | ChEMBL |
| GED-129 | ChEMBL |
| MP-214 | ChEMBL |
| RGH 188 | ChemIDplus |
| RGH-188 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 5037 | DrugCentral |
| Cariprazine | Wikipedia |
| D09997 | KEGG DRUG |
| DB06016 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18784658 | Reaxys |
| CAS:839712-12-8 | KEGG DRUG |
| CAS:839712-12-8 | ChemIDplus |
| Citations |
|---|