EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H32Cl2N4O |
| Net Charge | 0 |
| Average Mass | 427.420 |
| Monoisotopic Mass | 426.19532 |
| SMILES | CN(C)C(=O)N[C@H]1CC[C@H](CCN2CCN(c3cccc(Cl)c3Cl)CC2)CC1 |
| InChI | InChI=1S/C21H32Cl2N4O/c1-25(2)21(28)24-17-8-6-16(7-9-17)10-11-26-12-14-27(15-13-26)19-5-3-4-18(22)20(19)23/h3-5,16-17H,6-15H2,1-2H3,(H,24,28)/t16-,17- |
| InChIKey | KPWSJANDNDDRMB-QAQDUYKDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | dopamine agonist A drug that binds to and activates dopamine receptors. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | dopamine agonist A drug that binds to and activates dopamine receptors. second generation antipsychotic Antipsychotic drugs which can have different modes of action but which tend to be less likely than first generation antipsychotics to cause extrapyramidal motor control disabilities such as body rigidity or Parkinson's disease-type movements. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cariprazine (CHEBI:90933) has role dopamine agonist (CHEBI:51065) |
| cariprazine (CHEBI:90933) has role second generation antipsychotic (CHEBI:65191) |
| cariprazine (CHEBI:90933) has role serotonergic antagonist (CHEBI:48279) |
| cariprazine (CHEBI:90933) is a N-alkylpiperazine (CHEBI:46845) |
| cariprazine (CHEBI:90933) is a N-arylpiperazine (CHEBI:46848) |
| cariprazine (CHEBI:90933) is a dichlorobenzene (CHEBI:23697) |
| cariprazine (CHEBI:90933) is a ureas (CHEBI:47857) |
| cariprazine (CHEBI:90933) is conjugate base of cariprazine(1+) (CHEBI:90934) |
| Incoming Relation(s) |
| cariprazine(1+) (CHEBI:90934) is conjugate acid of cariprazine (CHEBI:90933) |
| IUPAC Name |
|---|
| N'-(trans-4-{2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl}cyclohexyl)-N,N-dimethylurea |
| INN | Source |
|---|---|
| cariprazine | KEGG DRUG |
| Synonyms | Source |
|---|---|
| RGH-188 | ChemIDplus |
| RGH 188 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D09997 | KEGG DRUG |
| DB06016 | DrugBank |
| Cariprazine | Wikipedia |
| 5037 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18784658 | Reaxys |
| CAS:839712-12-8 | KEGG DRUG |
| CAS:839712-12-8 | ChemIDplus |
| Citations |
|---|