EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H32Cl2N4O.HCl |
| Net Charge | 0 |
| Average Mass | 463.881 |
| Monoisotopic Mass | 462.17199 |
| SMILES | CN(C)C(=O)N[C@H]1CC[C@H](CCN2CCN(c3cccc(Cl)c3Cl)CC2)CC1.Cl |
| InChI | InChI=1S/C21H32Cl2N4O.ClH/c1-25(2)21(28)24-17-8-6-16(7-9-17)10-11-26-12-14-27(15-13-26)19-5-3-4-18(22)20(19)23;/h3-5,16-17H,6-15H2,1-2H3,(H,24,28);1H/t16-,17-; |
| InChIKey | GPPJWWMREQHLQT-BHQIMSFRSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. dopamine agonist A drug that binds to and activates dopamine receptors. |
| Applications: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. dopamine agonist A drug that binds to and activates dopamine receptors. second generation antipsychotic Antipsychotic drugs which can have different modes of action but which tend to be less likely than first generation antipsychotics to cause extrapyramidal motor control disabilities such as body rigidity or Parkinson's disease-type movements. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cariprazine hydrochloride (CHEBI:90932) has part cariprazine(1+) (CHEBI:90934) |
| cariprazine hydrochloride (CHEBI:90932) has role dopamine agonist (CHEBI:51065) |
| cariprazine hydrochloride (CHEBI:90932) has role second generation antipsychotic (CHEBI:65191) |
| cariprazine hydrochloride (CHEBI:90932) has role serotonergic antagonist (CHEBI:48279) |
| cariprazine hydrochloride (CHEBI:90932) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| N'-(trans-4-{2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl}cyclohexyl)-N,N-dimethylurea hydrochloride |
| Synonyms | Source |
|---|---|
| cariprazine.HCl | ChEBI |
| cariprazine monohydrochloride | ChEBI |
| RGH-188 HCL | ChemIDplus |
| Brand Name | Source |
|---|---|
| Vraylar | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| Cariprazine | Wikipedia |
| D09876 | KEGG DRUG |
| DB06016 | DrugBank |
| EP2251011 | Patent |
| US2011059980 | Patent |
| WO2009104739 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18784660 | Reaxys |
| CAS:1083076-69-0 | KEGG DRUG |
| CAS:1083076-69-0 | ChemIDplus |
| Citations |
|---|