EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14BrN3O2S |
| Net Charge | 0 |
| Average Mass | 404.289 |
| Monoisotopic Mass | 402.99901 |
| SMILES | O=C(O)CSc1nnc(Br)n1-c1ccc(C2CC2)c2ccccc12 |
| InChI | InChI=1S/C17H14BrN3O2S/c18-16-19-20-17(24-9-15(22)23)21(16)14-8-7-11(10-5-6-10)12-3-1-2-4-13(12)14/h1-4,7-8,10H,5-6,9H2,(H,22,23) |
| InChIKey | FGQFOYHRJSUHMR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | uricosuric drug A gout suppressant that acts directly on the renal tubule to increase the excretion of uric acid, thus reducing its concentrations in plasma. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lesinurad (CHEBI:90929) has role uricosuric drug (CHEBI:35841) |
| lesinurad (CHEBI:90929) is a aryl sulfide (CHEBI:35683) |
| lesinurad (CHEBI:90929) is a cyclopropanes (CHEBI:51454) |
| lesinurad (CHEBI:90929) is a monocarboxylic acid (CHEBI:25384) |
| lesinurad (CHEBI:90929) is a naphthalenes (CHEBI:25477) |
| lesinurad (CHEBI:90929) is a organobromine compound (CHEBI:37141) |
| lesinurad (CHEBI:90929) is a triazoles (CHEBI:35727) |
| IUPAC Name |
|---|
| {[5-bromo-4-(4-cyclopropylnaphthalen-1-yl)-4H-1,2,4-triazol-3-yl]sulfanyl}acetic acid |
| INN | Source |
|---|---|
| lesinurad | ChemIDplus |
| Synonyms | Source |
|---|---|
| RDEA 594 | ChemIDplus |
| RDEA594 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Zurampic | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12932464 | Reaxys |
| CAS:878672-00-5 | KEGG DRUG |
| CAS:878672-00-5 | ChemIDplus |
| Citations |
|---|