EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H28N4O3 |
| Net Charge | 0 |
| Average Mass | 444.535 |
| Monoisotopic Mass | 444.21614 |
| SMILES | COc1ccc2ncc(/C=C3\C(=O)Nc4ccc(NC(=O)CCN5CCCCC5)cc43)c2c1 |
| InChI | InChI=1S/C26H28N4O3/c1-33-19-6-8-23-20(15-19)17(16-27-23)13-22-21-14-18(5-7-24(21)29-26(22)32)28-25(31)9-12-30-10-3-2-4-11-30/h5-8,13-16,27H,2-4,9-12H2,1H3,(H,28,31)(H,29,32)/b22-13- |
| InChIKey | INQUULPXCZAKMS-XKZIYDEJSA-N |
| Roles Classification |
|---|
| Biological Role: | ERK dimerisation inhibitor An inhibitor that interferes with the dimerisation of extracellular signal-regulated kinase (ERK). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| DEL-22379 (CHEBI:90905) has role antineoplastic agent (CHEBI:35610) |
| DEL-22379 (CHEBI:90905) has role ERK dimerisation inhibitor (CHEBI:90961) |
| DEL-22379 (CHEBI:90905) is a enamide (CHEBI:51751) |
| DEL-22379 (CHEBI:90905) is a oxindoles (CHEBI:38459) |
| DEL-22379 (CHEBI:90905) is a piperidines (CHEBI:26151) |
| DEL-22379 (CHEBI:90905) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| N-{(3Z)-3-[(5-methoxy-1H-indol-3-yl)methylene]-2-oxo-2,3-dihydro-1H-indol-5-yl}-3-(piperidin-1-yl)propanamide |
| Synonyms | Source |
|---|---|
| N-{(3Z)-3-[(5-methoxy-1H-indol-3-yl)methylene]-2-oxo-2,3-dihydro-1H-indol-5-yl}-3-(piperidin-1-yl)propionamide | ChEBI |
| DEL22379 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18638308 | Reaxys |
| Citations |
|---|