EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H18N4O2 |
| Net Charge | 0 |
| Average Mass | 406.445 |
| Monoisotopic Mass | 406.14298 |
| SMILES | O=C1N[C@@H](Cc2cnc3ccccc23)c2nc3ccccc3c(=O)n2-c2ccccc21 |
| InChI | InChI=1S/C25H18N4O2/c30-24-18-9-3-6-12-22(18)29-23(27-20-11-5-2-8-17(20)25(29)31)21(28-24)13-15-14-26-19-10-4-1-7-16(15)19/h1-12,14,21,26H,13H2,(H,28,30)/t21-/m0/s1 |
| InChIKey | BUTFEAMXSRJHIM-NRFANRHFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus alliaceus (ncbitaxon:209559) | - | PubMed (3417561) | Strain: ATCC20655 and 20656 |
| Roles Classification |
|---|
| Biological Roles: | cholecystokinin antagonist A hormone antagonist that inhibits the action of the peptide hormone cholecystokinin. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | cholecystokinin antagonist A hormone antagonist that inhibits the action of the peptide hormone cholecystokinin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asperlicin C (CHEBI:90904) has role Aspergillus metabolite (CHEBI:76956) |
| asperlicin C (CHEBI:90904) has role cholecystokinin antagonist (CHEBI:73296) |
| asperlicin C (CHEBI:90904) is a asperlicins (CHEBI:91003) |
| asperlicin C (CHEBI:90904) is a indoles (CHEBI:24828) |
| asperlicin C (CHEBI:90904) is a organic heterotetracyclic compound (CHEBI:38163) |
| IUPAC Name |
|---|
| (7S)-7-(1H-indol-3-ylmethyl)-6,7-dihydroquinazolino[3,2-a][1,4]benzodiazepine-5,13-dione |
| Synonym | Source |
|---|---|
| (−)-asperlicin C | ChEBI |
| UniProt Name | Source |
|---|---|
| asperlicin C | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-17021 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8016853 | Reaxys |
| CAS:93413-06-0 | ChemIDplus |
| Citations |
|---|