EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H18N4O2 |
| Net Charge | 0 |
| Average Mass | 406.445 |
| Monoisotopic Mass | 406.14298 |
| SMILES | O=C1N[C@@H](Cc2cnc3ccccc23)c2nc3ccccc3c(=O)n2-c2ccccc21 |
| InChI | InChI=1S/C25H18N4O2/c30-24-18-9-3-6-12-22(18)29-23(27-20-11-5-2-8-17(20)25(29)31)21(28-24)13-15-14-26-19-10-4-1-7-16(15)19/h1-12,14,21,26H,13H2,(H,28,30)/t21-/m0/s1 |
| InChIKey | BUTFEAMXSRJHIM-NRFANRHFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus alliaceus (ncbitaxon:209559) | - | PubMed (3417561) | Strain: ATCC20655 and 20656 |
| Roles Classification |
|---|
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . cholecystokinin antagonist A hormone antagonist that inhibits the action of the peptide hormone cholecystokinin. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | cholecystokinin antagonist A hormone antagonist that inhibits the action of the peptide hormone cholecystokinin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asperlicin C (CHEBI:90904) has role Aspergillus metabolite (CHEBI:76956) |
| asperlicin C (CHEBI:90904) has role cholecystokinin antagonist (CHEBI:73296) |
| asperlicin C (CHEBI:90904) is a asperlicins (CHEBI:91003) |
| asperlicin C (CHEBI:90904) is a indoles (CHEBI:24828) |
| asperlicin C (CHEBI:90904) is a organic heterotetracyclic compound (CHEBI:38163) |
| IUPAC Name |
|---|
| (7S)-7-(1H-indol-3-ylmethyl)-6,7-dihydroquinazolino[3,2-a][1,4]benzodiazepine-5,13-dione |
| Synonym | Source |
|---|---|
| (−)-asperlicin C | ChEBI |
| UniProt Name | Source |
|---|---|
| asperlicin C | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-17021 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8016853 | Reaxys |
| CAS:93413-06-0 | ChemIDplus |
| Citations |
|---|