EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H18N4O3 |
| Net Charge | 0 |
| Average Mass | 422.444 |
| Monoisotopic Mass | 422.13789 |
| SMILES | [H][C@]12Nc3ccccc3[C@@]1(O)C[C@H]1c3nc4ccccc4c(=O)n3-c3ccccc3C(=O)N12 |
| InChI | InChI=1S/C25H18N4O3/c30-22-14-7-1-4-10-17(14)26-21-20-13-25(32)16-9-3-5-11-18(16)27-24(25)29(20)23(31)15-8-2-6-12-19(15)28(21)22/h1-12,20,24,27,32H,13H2/t20-,24+,25-/m0/s1 |
| InChIKey | HYHLSEUXMRFVND-AMDXRBSFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus alliaceus (ncbitaxon:209559) | - | PubMed (3417561) | Strain: ATCC20655 and 20656 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | cholecystokinin antagonist A hormone antagonist that inhibits the action of the peptide hormone cholecystokinin. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | cholecystokinin antagonist A hormone antagonist that inhibits the action of the peptide hormone cholecystokinin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asperlicin E (CHEBI:90903) has role Aspergillus metabolite (CHEBI:76956) |
| asperlicin E (CHEBI:90903) has role cholecystokinin antagonist (CHEBI:73296) |
| asperlicin E (CHEBI:90903) is a aminal (CHEBI:35412) |
| asperlicin E (CHEBI:90903) is a asperlicins (CHEBI:91003) |
| asperlicin E (CHEBI:90903) is a organic heteroheptacyclic compound (CHEBI:52157) |
| asperlicin E (CHEBI:90903) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (12aR,17bS,18aS)-17b-hydroxy-13,17b,18,18a-tetrahydro-11H-indolo[3',2':4,5]pyrrolo[2,1-c]quinazolino[3,2-a][1,4]benzodiazepine-5,11(12aH)-dione |
| Synonym | Source |
|---|---|
| (+)-asperlicin E | ChEBI |
| UniProt Name | Source |
|---|---|
| asperlicin E | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-17023 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23125539 | Reaxys |
| CAS:93413-05-9 | ChemIDplus |
| Citations |
|---|