EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H15N3O4 |
| Net Charge | 0 |
| Average Mass | 373.368 |
| Monoisotopic Mass | 373.10626 |
| SMILES | O=C(O)c1nc(-c2cnc3ccc(O)cc23)cc1-c1c(O)nc2ccccc12 |
| InChI | InChI=1S/C21H15N3O4/c25-10-5-6-15-12(7-10)14(9-22-15)17-8-13(19(23-17)21(27)28)18-11-3-1-2-4-16(11)24-20(18)26/h1-9,22-26H,(H,27,28) |
| InChIKey | AVEFAUDTSHGJQO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chromobacterium violaceum (ncbitaxon:536) | - | PubMed (21779844) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| violaceinic acid (CHEBI:90899) has role bacterial metabolite (CHEBI:76969) |
| violaceinic acid (CHEBI:90899) is a hydroxyindoles (CHEBI:84729) |
| violaceinic acid (CHEBI:90899) is a monocarboxylic acid (CHEBI:25384) |
| violaceinic acid (CHEBI:90899) is a pyrrolecarboxylic acid (CHEBI:26454) |
| violaceinic acid (CHEBI:90899) is conjugate acid of violaceinate (CHEBI:90900) |
| Incoming Relation(s) |
| violaceinate (CHEBI:90900) is conjugate base of violaceinic acid (CHEBI:90899) |
| IUPAC Name |
|---|
| 3-(2-hydroxy-1H-indol-3-yl)-5-(5-hydroxy-1H-indol-3-yl)-1H-pyrrole-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD-14324 | MetaCyc |
| Citations |
|---|