EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H33NO2 |
| Net Charge | 0 |
| Average Mass | 379.544 |
| Monoisotopic Mass | 379.25113 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/Cc1c(C)n(O)c2ccccc2c1=O |
| InChI | InChI=1S/C25H33NO2/c1-18(2)10-8-11-19(3)12-9-13-20(4)16-17-22-21(5)26(28)24-15-7-6-14-23(24)25(22)27/h6-7,10,12,14-16,28H,8-9,11,13,17H2,1-5H3/b19-12+,20-16+ |
| InChIKey | FIHXCHBEHLCXEG-YEFHWUCQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stigmatella aurantiaca Sg a15 (ncbitaxon:675526) | - | PubMed (3106289) | Strain: Sg a15 |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. EC 1.8.5.4 (sulfide:quinone reductase) inhibitor An EC 1.8.5.* (oxidoreductase acting on sulfur group donors, quinone or similar as acceptor) inhibitor that interferes with the action of sulfide:quinone reductase (EC 1.8.5.4). bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aurachin C (CHEBI:90888) has role antibacterial agent (CHEBI:33282) |
| aurachin C (CHEBI:90888) has role bacterial metabolite (CHEBI:76969) |
| aurachin C (CHEBI:90888) has role EC 1.8.5.4 (sulfide:quinone reductase) inhibitor (CHEBI:90921) |
| aurachin C (CHEBI:90888) is a C-type aurachin (CHEBI:90918) |
| aurachin C (CHEBI:90888) is a hydroxylamines (CHEBI:24709) |
| aurachin C (CHEBI:90888) is a organic heterobicyclic compound (CHEBI:27171) |
| aurachin C (CHEBI:90888) is a quinolone (CHEBI:23765) |
| Incoming Relation(s) |
| aurachin C epoxide (CHEBI:90889) has functional parent aurachin C (CHEBI:90888) |
| IUPAC Name |
|---|
| 1-hydroxy-2-methyl-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]quinolin-4(1H)-one |
| Synonym | Source |
|---|---|
| aurachin-C | ChemIDplus |
| UniProt Name | Source |
|---|---|
| aurachin C | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19334109 | Reaxys |
| CAS:108354-14-9 | ChemIDplus |
| Citations |
|---|