EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H31O3 |
| Net Charge | -1 |
| Average Mass | 343.487 |
| Monoisotopic Mass | 343.22787 |
| SMILES | CC/C=C\C/C=C\CC(O)/C=C/C=C\C/C=C\C/C=C\CCC(=O)[O-] |
| InChI | InChI=1S/C22H32O3/c1-2-3-4-5-12-15-18-21(23)19-16-13-10-8-6-7-9-11-14-17-20-22(24)25/h3-4,6-7,10-16,19,21,23H,2,5,8-9,17-18,20H2,1H3,(H,24,25)/p-1/b4-3-,7-6-,13-10-,14-11-,15-12-,19-16+ |
| InChIKey | ZNEBXONKCYFJAF-BGKMTWLOSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (25586183) |
| Roles Classification |
|---|
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 14-HDoHE(1−) (CHEBI:90866) has role human xenobiotic metabolite (CHEBI:76967) |
| 14-HDoHE(1−) (CHEBI:90866) is a hydroxy fatty acid anion (CHEBI:59835) |
| 14-HDoHE(1−) (CHEBI:90866) is a hydroxydocosahexaenoate (CHEBI:131867) |
| 14-HDoHE(1−) (CHEBI:90866) is a long-chain fatty acid anion (CHEBI:57560) |
| 14-HDoHE(1−) (CHEBI:90866) is a polyunsaturated fatty acid anion (CHEBI:76567) |
| 14-HDoHE(1−) (CHEBI:90866) is conjugate base of 14-HDoHE (CHEBI:72647) |
| Incoming Relation(s) |
| (14R)-HDoHE(1−) (CHEBI:136525) is a 14-HDoHE(1−) (CHEBI:90866) |
| (14S)-HDoHE(1−) (CHEBI:136526) is a 14-HDoHE(1−) (CHEBI:90866) |
| 14-HDoHE (CHEBI:72647) is conjugate acid of 14-HDoHE(1−) (CHEBI:90866) |
| IUPAC Name |
|---|
| (4Z,7Z,10Z,12E,16Z,19Z)-14-hydroxydocosa-4,7,10,12,16,19-hexaenoate |
| Synonym | Source |
|---|---|
| (4Z,7Z,10Z,12E,16Z,19Z)-14-hydroxydocosahexaenoate | ChEBI |
| UniProt Name | Source |
|---|---|
| 14-hydroxy-(4Z,7Z,10Z,12E,16Z,19Z)-docosahexaenoate | UniProt |
| Citations |
|---|