EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C21H21F3IN3O2.C4H4O4 |
| Net Charge | 0 |
| Average Mass | 1178.704 |
| Monoisotopic Mass | 1178.13708 |
| SMILES | O=C(O)/C=C/C(=O)O.O=C(c1ccc(F)c(F)c1Nc1ccc(I)cc1F)N1CC(O)([C@@H]2CCCCN2)C1.O=C(c1ccc(F)c(F)c1Nc1ccc(I)cc1F)N1CC(O)([C@@H]2CCCCN2)C1 |
| InChI | InChI=1S/2C21H21F3IN3O2.C4H4O4/c2*22-14-6-5-13(19(18(14)24)27-16-7-4-12(25)9-15(16)23)20(29)28-10-21(30,11-28)17-3-1-2-8-26-17;5-3(6)1-2-4(7)8/h2*4-7,9,17,26-27,30H,1-3,8,10-11H2;1-2H,(H,5,6)(H,7,8)/b;;2-1+/t2*17-;/m00./s1 |
| InChIKey | RESIMIUSNACMNW-BXRWSSRYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of mitogen-activated protein kinase (EC 2.7.11.24). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cobimetinib fumarate (CHEBI:90853) has part cobimetinib(1+) (CHEBI:90854) |
| cobimetinib fumarate (CHEBI:90853) has role antineoplastic agent (CHEBI:35610) |
| cobimetinib fumarate (CHEBI:90853) has role EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor (CHEBI:79091) |
| cobimetinib fumarate (CHEBI:90853) is a carbonyl compound (CHEBI:36586) |
| cobimetinib fumarate (CHEBI:90853) is a fumarate salt (CHEBI:50921) |
| cobimetinib fumarate (CHEBI:90853) is a organic molecular entity (CHEBI:50860) |
| cobimetinib fumarate (CHEBI:90853) is a organoammonium salt (CHEBI:46850) |
| cobimetinib fumarate (CHEBI:90853) is a organohalogen compound (CHEBI:17792) |
| IUPAC Name |
|---|
| bis[(2S)-2-{1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]-3-hydroxyazetidin-3-yl}piperidin-1-ium] (2E)-but-2-enedioate |
| Synonyms | Source |
|---|---|
| cobimetinib | ChEBI |
| Cobimetinib hemifumarate | ChemIDplus |
| GDC-0973 hemifumarate | ChemIDplus |
| Xl-518 hemifumarate | ChemIDplus |
| Brand Name | Source |
|---|---|
| COTELLIC | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| Cobimetinib | Wikipedia |
| D10615 | KEGG DRUG |
| DB05239 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:1369665-02-0 | KEGG DRUG |
| Citations |
|---|