EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H21F3IN3O2 |
| Net Charge | 0 |
| Average Mass | 531.316 |
| Monoisotopic Mass | 531.06306 |
| SMILES | O=C(c1ccc(F)c(F)c1Nc1ccc(I)cc1F)N1CC(O)([C@@H]2CCCCN2)C1 |
| InChI | InChI=1S/C21H21F3IN3O2/c22-14-6-5-13(19(18(14)24)27-16-7-4-12(25)9-15(16)23)20(29)28-10-21(30,11-28)17-3-1-2-8-26-17/h4-7,9,17,26-27,30H,1-3,8,10-11H2/t17-/m0/s1 |
| InChIKey | BSMCAPRUBJMWDF-KRWDZBQOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of mitogen-activated protein kinase (EC 2.7.11.24). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cobimetinib (CHEBI:90851) has role antineoplastic agent (CHEBI:35610) |
| cobimetinib (CHEBI:90851) has role EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor (CHEBI:79091) |
| cobimetinib (CHEBI:90851) is a N-acylazetidine (CHEBI:46959) |
| cobimetinib (CHEBI:90851) is a aromatic amine (CHEBI:33860) |
| cobimetinib (CHEBI:90851) is a difluorobenzene (CHEBI:38582) |
| cobimetinib (CHEBI:90851) is a organoiodine compound (CHEBI:37142) |
| cobimetinib (CHEBI:90851) is a piperidines (CHEBI:26151) |
| cobimetinib (CHEBI:90851) is a secondary amino compound (CHEBI:50995) |
| cobimetinib (CHEBI:90851) is a tertiary alcohol (CHEBI:26878) |
| cobimetinib (CHEBI:90851) is conjugate base of cobimetinib(1+) (CHEBI:90854) |
| Incoming Relation(s) |
| cobimetinib(1+) (CHEBI:90854) is conjugate acid of cobimetinib (CHEBI:90851) |
| IUPAC Name |
|---|
| [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]{3-hydroxy-3-[(2S)-piperidin-2-yl]azetidin-1-yl}methanone |
| INN | Source |
|---|---|
| cobimetinib | KEGG DRUG |
| Synonyms | Source |
|---|---|
| XL518 | ChemIDplus |
| Xl-518 | ChemIDplus |
| GDC 0973 | ChemIDplus |
| RG 7420 | ChemIDplus |
| Xl 518 | ChemIDplus |
| GDC-0973 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D10405 | KEGG DRUG |
| EUI | PDBeChem |
| Cobimetinib | Wikipedia |
| DB05239 | DrugBank |
| 5046 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12883594 | Reaxys |
| CAS:934660-93-2 | KEGG DRUG |
| CAS:934660-93-2 | ChemIDplus |
| Citations |
|---|