EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H32BrNO4S2 |
| Net Charge | 0 |
| Average Mass | 626.638 |
| Monoisotopic Mass | 625.09561 |
| SMILES | Cc1cc(C)c(S(=O)(=O)N(CCc2cccc(Br)c2)Cc2ccc(-c3cccc(S(C)(=O)=O)c3)cc2)c(C)c1 |
| InChI | InChI=1S/C31H32BrNO4S2/c1-22-17-23(2)31(24(3)18-22)39(36,37)33(16-15-25-7-5-9-29(32)19-25)21-26-11-13-27(14-12-26)28-8-6-10-30(20-28)38(4,34)35/h5-14,17-20H,15-16,21H2,1-4H3 |
| InChIKey | FYQFEJFTCLKXTQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. liver X receptor inverse agonist An inverse agonist that binds to the same receptor as a liver X receptor agonist, but which induces a pharmacological response opposite to that agonist. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SR9243 (CHEBI:90842) has role antineoplastic agent (CHEBI:35610) |
| SR9243 (CHEBI:90842) has role apoptosis inducer (CHEBI:68495) |
| SR9243 (CHEBI:90842) has role liver X receptor inverse agonist (CHEBI:90846) |
| SR9243 (CHEBI:90842) is a bromobenzenes (CHEBI:37149) |
| SR9243 (CHEBI:90842) is a sulfonamide (CHEBI:35358) |
| SR9243 (CHEBI:90842) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| N-[2-(3-bromophenyl)ethyl]-2,4,6-trimethyl-N-{[3'-(methylsulfonyl)biphenyl-4-yl]methyl}benzenesulfonamide |
| Synonyms | Source |
|---|---|
| SR-9243 | ChEBI |
| SR 9243 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:26903919 | Reaxys |
| Citations |
|---|