EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22N2O8 |
| Net Charge | 0 |
| Average Mass | 322.314 |
| Monoisotopic Mass | 322.13762 |
| SMILES | CC(=O)N[C@H]1[C@H](O[C@H](C)[C@H](N)C(=O)O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H22N2O8/c1-4(7(13)11(19)20)21-12-8(14-5(2)16)10(18)9(17)6(3-15)22-12/h4,6-10,12,15,17-18H,3,13H2,1-2H3,(H,14,16)(H,19,20)/t4-,6-,7+,8-,9-,10-,12-/m1/s1 |
| InChIKey | KUIFHYPNNRVEKZ-BIORGJIFSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-O-(N-acetyl-β-D-glucosaminyl)-L-threonine (CHEBI:90839) is a O-glycosyl-L-threonine (CHEBI:21958) |
| 3-O-(N-acetyl-β-D-glucosaminyl)-L-threonine (CHEBI:90839) is a monosaccharide derivative (CHEBI:63367) |
| 3-O-(N-acetyl-β-D-glucosaminyl)-L-threonine (CHEBI:90839) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| Incoming Relation(s) |
| O-(N-acetyl-β-D-glucosaminyl)-L-threonine residue (CHEBI:90840) is substituent group from 3-O-(N-acetyl-β-D-glucosaminyl)-L-threonine (CHEBI:90839) |
| Synonym | Source |
|---|---|
| O-(2-acetamido-2-deoxy-β-D-glucopyranosyl)-L-threonine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11223411 | Reaxys |