EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H20N2O8 |
| Net Charge | 0 |
| Average Mass | 308.287 |
| Monoisotopic Mass | 308.12197 |
| SMILES | CC(=O)N[C@H]1[C@H](OC[C@H](N)C(=O)O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H20N2O8/c1-4(15)13-7-9(17)8(16)6(2-14)21-11(7)20-3-5(12)10(18)19/h5-9,11,14,16-17H,2-3,12H2,1H3,(H,13,15)(H,18,19)/t5-,6+,7+,8+,9+,11+/m0/s1 |
| InChIKey | REDMNGDGDYFZRE-YRMXFSIDSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-O-(N-acetyl-β-D-glucosaminyl)-L-serine (CHEBI:90837) is a O-glycosyl-L-serine (CHEBI:21957) |
| 3-O-(N-acetyl-β-D-glucosaminyl)-L-serine (CHEBI:90837) is a monosaccharide derivative (CHEBI:63367) |
| 3-O-(N-acetyl-β-D-glucosaminyl)-L-serine (CHEBI:90837) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| Incoming Relation(s) |
| O-(N-acetyl-β-D-glucosaminyl)-L-serine residue (CHEBI:90838) is substituent group from 3-O-(N-acetyl-β-D-glucosaminyl)-L-serine (CHEBI:90837) |
| Synonyms | Source |
|---|---|
| 3-O-(2-Acetamido-2-deoxy-beta-D-glucopyranosyl)-L-serine | ChemIDplus |
| O-Seryl-beta-N-acetylglucosaminide | ChemIDplus |
| O-(2-acetamido-2-deoxy-β-D-glucopyranosyl)-L-serine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1437875 | Reaxys |
| CAS:17041-36-0 | ChemIDplus |
| Citations |
|---|