EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O5 |
| Net Charge | 0 |
| Average Mass | 352.471 |
| Monoisotopic Mass | 352.22497 |
| SMILES | CCCCCC(O)/C=C/C=C\C/C=C\C=C\C(CCCC(=O)O)OO |
| InChI | InChI=1S/C20H32O5/c1-2-3-9-13-18(21)14-10-7-5-4-6-8-11-15-19(25-24)16-12-17-20(22)23/h5-8,10-11,14-15,18-19,21,24H,2-4,9,12-13,16-17H2,1H3,(H,22,23)/b7-5-,8-6-,14-10+,15-11+ |
| InChIKey | AZHSPOPOMNJPFD-PCTZFDORSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (8615788) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroperoxy-15-HETE (CHEBI:90833) has role human metabolite (CHEBI:77746) |
| 5-hydroperoxy-15-HETE (CHEBI:90833) is a hydroperoxy(hydroxy)icosatetraenoic acid (CHEBI:138327) |
| 5-hydroperoxy-15-HETE (CHEBI:90833) is conjugate acid of 5-hydroperoxy-15-HETE(1−) (CHEBI:90631) |
| Incoming Relation(s) |
| (5S,15S)-5-hydroperoxy-15-HETE (CHEBI:131562) is a 5-hydroperoxy-15-HETE (CHEBI:90833) |
| 5-hydroperoxy-15-HETE(1−) (CHEBI:90631) is conjugate base of 5-hydroperoxy-15-HETE (CHEBI:90833) |
| IUPAC Name |
|---|
| (6E,8Z,11Z,13E)-5-hydroperoxy-15-hydroxyicosa-6,8,11,13-tetraenoic acid |
| Synonym | Source |
|---|---|
| 5-Hp-15-HETE | ChEBI |
| Citations |
|---|