EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H19F2N5O2 |
| Net Charge | 0 |
| Average Mass | 423.423 |
| Monoisotopic Mass | 423.15068 |
| SMILES | CC(=O)Nc1cc(Oc2ccc3c(nc(Nc4ccc(F)cc4F)n3C)c2C)ccn1 |
| InChI | InChI=1S/C22H19F2N5O2/c1-12-19(31-15-8-9-25-20(11-15)26-13(2)30)7-6-18-21(12)28-22(29(18)3)27-17-5-4-14(23)10-16(17)24/h4-11H,1-3H3,(H,27,28)(H,25,26,30) |
| InChIKey | KQQLBXFPTDVFAJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that specifically blocks the action of non-specific protein-tyrosine kinase (EC 2.7.10.2). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CHZ868 (CHEBI:90828) has role antineoplastic agent (CHEBI:35610) |
| CHZ868 (CHEBI:90828) has role EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor (CHEBI:76617) |
| CHZ868 (CHEBI:90828) is a acetamides (CHEBI:22160) |
| CHZ868 (CHEBI:90828) is a aromatic amine (CHEBI:33860) |
| CHZ868 (CHEBI:90828) is a aromatic ether (CHEBI:35618) |
| CHZ868 (CHEBI:90828) is a benzimidazoles (CHEBI:22715) |
| CHZ868 (CHEBI:90828) is a difluorobenzene (CHEBI:38582) |
| CHZ868 (CHEBI:90828) is a pyridines (CHEBI:26421) |
| CHZ868 (CHEBI:90828) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| N-(4-{[2-(2,4-difluoroanilino)-1,4-dimethyl-1H-benzimidazol-5-yl]oxy}pyridin-2-yl)acetamide |
| Synonyms | Source |
|---|---|
| CHZ 868 | ChEBI |
| CHZ-868 | ChEBI |
| N-[4-[2-[[2,4-bis(fluoranyl)phenyl]amino]-1,4-dimethyl-benzimidazol-5-yl]oxypyridin-2-yl]ethanamide | ChEBI |
| Citations |
|---|