EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H34MgN4O6 |
| Net Charge | -2 |
| Average Mass | 630.984 |
| Monoisotopic Mass | 630.23397 |
| SMILES | CCC1=C(C)C2=[N+]3C1=Cc1c(C)c4c5[n]1[Mg-2]31[n]3c(c(C)c(C(C)O)c3=C2)=CC2=[N+]1C(=C5[C-](C(=O)OC)C4=O)[C@@H](CCC(=O)[O-])[C@@H]2C |
| InChI | InChI=1S/C35H37N4O6.Mg/c1-8-19-14(2)21-13-26-28(18(6)40)16(4)23(37-26)11-22-15(3)20(9-10-27(41)42)32(38-22)30-31(35(44)45-7)34(43)29-17(5)24(39-33(29)30)12-25(19)36-21;/h11-13,15,18,20,40H,8-10H2,1-7H3,(H3,36,37,38,39,41,42,43);/q-1;+2/p-3/t15-,18?,20-;/m0./s1 |
| InChIKey | NVCVIPRLIABPAM-TTWAWOKTSA-K |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlorobaculum tepidum (ncbitaxon:1097) | - | PubMed (26088139) |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(1-hydroxyethyl)chlorophyllide a(2−) (CHEBI:90792) has role bacterial metabolite (CHEBI:76969) |
| 3-(1-hydroxyethyl)chlorophyllide a(2−) (CHEBI:90792) is a cyclic tetrapyrrole anion (CHEBI:58941) |
| 3-(1-hydroxyethyl)chlorophyllide a(2−) (CHEBI:90792) is a monocarboxylic acid anion (CHEBI:35757) |
| 3-(1-hydroxyethyl)chlorophyllide a(2−) (CHEBI:90792) is conjugate base of 3-(1-hydroxyethyl)chlorophyllide a (CHEBI:81545) |
| Incoming Relation(s) |
| 3-(1-hydroxyethyl)chlorophyllide a (CHEBI:81545) is conjugate acid of 3-(1-hydroxyethyl)chlorophyllide a(2−) (CHEBI:90792) |
| IUPAC Name |
|---|
| {3-[(3S,4S)-14-ethyl-9-(1-hydroxyethyl)-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxophorbin-3-yl-κ4N23,N24,N25,N26]propanoato(4−)}magnesate(2−) |
| Synonym | Source |
|---|---|
| 3-hydroxyethylchlorophyllide a(2−) | ChEBI |
| UniProt Name | Source |
|---|---|
| 3-devinyl-3-(1-hydroxyethyl)chlorophyllide a | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-9064 | MetaCyc |
| Citations |
|---|