EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O3 |
| Net Charge | 0 |
| Average Mass | 318.457 |
| Monoisotopic Mass | 318.21949 |
| SMILES | CCCCC/C=C\C=C\C(=O)C/C=C\C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H30O3/c1-2-3-4-5-7-10-13-16-19(21)17-14-11-8-6-9-12-15-18-20(22)23/h6-7,9-11,13-14,16H,2-5,8,12,15,17-18H2,1H3,(H,22,23)/b9-6-,10-7-,14-11-,16-13+ |
| InChIKey | SFIBXKABWRNYKQ-RLZWZWKOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (23945567) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11-oxo-ETE (CHEBI:90776) has functional parent icosa-5,8,12,14-tetraenoic acid (CHEBI:36302) |
| 11-oxo-ETE (CHEBI:90776) has role human metabolite (CHEBI:77746) |
| 11-oxo-ETE (CHEBI:90776) is a enone (CHEBI:51689) |
| 11-oxo-ETE (CHEBI:90776) is a oxoicosatetraenoic acid (CHEBI:61704) |
| 11-oxo-ETE (CHEBI:90776) is conjugate acid of 11-oxo-ETE(1−) (CHEBI:90697) |
| Incoming Relation(s) |
| 11-oxo-ETE-CoA (CHEBI:137445) has functional parent 11-oxo-ETE (CHEBI:90776) |
| 11-oxo-ETE(1−) (CHEBI:90697) is conjugate base of 11-oxo-ETE (CHEBI:90776) |
| IUPAC Name |
|---|
| (5Z,8Z,12E,14Z)-11-oxoicosa-5,8,12,14-tetraenoic acid |
| Synonyms | Source |
|---|---|
| 11-KETE | ChEBI |
| (5Z,8Z,12E,14Z)-11-oxoeicosatetraenoic acid | ChEBI |
| (5Z,8Z,12E,14Z)-11-oxoicosatetraenoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19190344 | Reaxys |
| Citations |
|---|