EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H24O2 |
| Net Charge | 0 |
| Average Mass | 380.487 |
| Monoisotopic Mass | 380.17763 |
| SMILES | CC1(C)CC=C(c2ccccc2)c2cc(/C=C/c3ccc(C(=O)O)cc3)ccc21 |
| InChI | InChI=1S/C27H24O2/c1-27(2)17-16-23(21-6-4-3-5-7-21)24-18-20(12-15-25(24)27)9-8-19-10-13-22(14-11-19)26(28)29/h3-16,18H,17H2,1-2H3,(H,28,29)/b9-8+ |
| InChIKey | VUODRPPTYLBGFM-CMDGGOBGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | retinoic acid receptor beta agonist Any retinoic acid receptor (RAR) agonist with specificity for RARβ. teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. retinoic acid receptor gamma antagonist A retinoic acid receptor antagonist that antagonises retinoic acid receptor γ. retinoic acid receptor alpha antagonist A retinoic acid receptor antagonist that antagonises retinoic acid receptor α. |
| Applications: | retinoic acid receptor beta agonist Any retinoic acid receptor (RAR) agonist with specificity for RARβ. retinoic acid receptor gamma antagonist A retinoic acid receptor antagonist that antagonises retinoic acid receptor γ. retinoic acid receptor alpha antagonist A retinoic acid receptor antagonist that antagonises retinoic acid receptor α. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BMS-453 (CHEBI:90739) has role retinoic acid receptor α antagonist (CHEBI:90713) |
| BMS-453 (CHEBI:90739) has role retinoic acid receptor β agonist (CHEBI:90742) |
| BMS-453 (CHEBI:90739) has role retinoic acid receptor γ antagonist (CHEBI:90744) |
| BMS-453 (CHEBI:90739) has role teratogenic agent (CHEBI:50905) |
| BMS-453 (CHEBI:90739) is a benzoic acids (CHEBI:22723) |
| BMS-453 (CHEBI:90739) is a dihydronaphthalenes (CHEBI:90740) |
| BMS-453 (CHEBI:90739) is a stilbenoid (CHEBI:26776) |
| IUPAC Name |
|---|
| 4-[(E)-2-(5,5-dimethyl-8-phenyl-5,6-dihydronaphthalen-2-yl)vinyl]benzoic acid |
| Synonyms | Source |
|---|---|
| BMS 453 | ChemIDplus |
| BMS 189453 | ChemIDplus |
| BMS453 | ChemIDplus |
| BMS-189453 | ChEBI |
| BMS189453 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:24186643 | Reaxys |
| CAS:166977-43-1 | ChemIDplus |
| Citations |
|---|