EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:90721 - N-[3-(aminomethyl)benzyl]acetamidine
| Formula | C10H15N3 |
| Net Charge | 0 |
| Average Mass | 177.251 |
| Monoisotopic Mass | 177.12660 |
| SMILES | CC(=N)NCc1cccc(CN)c1 |
| InChI | InChI=1S/C10H15N3/c1-8(12)13-7-10-4-2-3-9(5-10)6-11/h2-5H,6-7,11H2,1H3,(H2,12,13) |
| InChIKey | RODUKNYOEVZQPR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 1.14.13.39 (nitric oxide synthase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of nitric oxide synthase (EC 1.14.13.39). |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[3-(aminomethyl)benzyl]acetamidine (CHEBI:90721) has role angiogenesis inhibitor (CHEBI:48422) |
| N-[3-(aminomethyl)benzyl]acetamidine (CHEBI:90721) has role EC 1.14.13.39 (nitric oxide synthase) inhibitor (CHEBI:61908) |
| N-[3-(aminomethyl)benzyl]acetamidine (CHEBI:90721) has role geroprotector (CHEBI:176497) |
| N-[3-(aminomethyl)benzyl]acetamidine (CHEBI:90721) is a aralkylamine (CHEBI:18000) |
| N-[3-(aminomethyl)benzyl]acetamidine (CHEBI:90721) is a carboxamidine (CHEBI:35359) |
| N-[3-(aminomethyl)benzyl]acetamidine (CHEBI:90721) is a primary amino compound (CHEBI:50994) |
| IUPAC Name |
|---|
| N-{[3-(aminomethyl)phenyl]methyl}ethanimidamide |
| Synonyms | Source |
|---|---|
| 1400W | ChEBI |
| W1400 | ChEBI |
| 1400 W | ChEBI |
| W 1400 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8054187 | Reaxys |
| CAS:180001-34-7 | ChemIDplus |
| Citations |
|---|