EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H31O4 |
| Net Charge | -1 |
| Average Mass | 335.464 |
| Monoisotopic Mass | 335.22278 |
| SMILES | O=C([O-])CCCC(O)/C=C/C=C\C/C=C\C/C=C\CCCCCO |
| InChI | InChI=1S/C20H32O4/c21-18-13-11-9-7-5-3-1-2-4-6-8-10-12-15-19(22)16-14-17-20(23)24/h2-5,8,10,12,15,19,21-22H,1,6-7,9,11,13-14,16-18H2,(H,23,24)/p-1/b4-2-,5-3-,10-8-,15-12+ |
| InChIKey | IWYJGYZCHKEPCK-DHYYJNSCSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,20-DiHETE(1−) (CHEBI:90715) is a dihydroxyicosatetraenoate (CHEBI:131877) |
| 5,20-DiHETE(1−) (CHEBI:90715) is a icosanoid anion (CHEBI:62937) |
| 5,20-DiHETE(1−) (CHEBI:90715) is a polyunsaturated fatty acid anion (CHEBI:76567) |
| 5,20-DiHETE(1−) (CHEBI:90715) is a ω-hydroxy-long-chain fatty acid anion (CHEBI:140992) |
| 5,20-DiHETE(1−) (CHEBI:90715) is conjugate base of 5,20-DiHETE (CHEBI:90979) |
| Incoming Relation(s) |
| 5,20-DiHETE (CHEBI:90979) is conjugate acid of 5,20-DiHETE(1−) (CHEBI:90715) |
| IUPAC Name |
|---|
| (6E,8Z,11Z,14Z)-5,20-dihydroxyicosa-6,8,11,14-tetraenoate |
| Synonyms | Source |
|---|---|
| 5,20-dihydroxy-6E,8Z,11Z,14Z-eicosatetraenoate | SUBMITTER |
| 5,20-dihydroxy-6E,8Z,11Z,14Z-icosatetraenoate | ChEBI |
| (6E,8Z,11Z,14Z)-5,20-dihydroxyicosatetraenoate | ChEBI |
| UniProt Name | Source |
|---|---|
| 5,20-dihydroxy-(6E,8Z,11Z,14Z)-eicosatetraenoate | UniProt |
| Citations |
|---|