EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H16FN3OS |
| Net Charge | 0 |
| Average Mass | 377.444 |
| Monoisotopic Mass | 377.09981 |
| SMILES | CS(=O)c1ccc(-c2nc(-c3ccncc3)c(-c3ccc(F)cc3)n2)cc1 |
| InChI | InChI=1S/C21H16FN3OS/c1-27(26)18-8-4-16(5-9-18)21-24-19(14-2-6-17(22)7-3-14)20(25-21)15-10-12-23-13-11-15/h2-13H,1H3,(H,24,25) |
| InChIKey | CDMGBJANTYXAIV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of non-specific serine/threonine protein kinase (EC 2.7.11.1), a kinase enzyme involved in phosphorylation of hydroxy group of serine or threonine. Hsp90 inhibitor An EC 3.6.4.10 (non-chaperonin molecular chaperone ATPase) inhibitor that blocks the action of heat shock protein 90. EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of mitogen-activated protein kinase (EC 2.7.11.24). |
| Applications: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SB 203580 (CHEBI:90705) has role EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor (CHEBI:50925) |
| SB 203580 (CHEBI:90705) has role EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor (CHEBI:79091) |
| SB 203580 (CHEBI:90705) has role geroprotector (CHEBI:176497) |
| SB 203580 (CHEBI:90705) has role Hsp90 inhibitor (CHEBI:63962) |
| SB 203580 (CHEBI:90705) has role neuroprotective agent (CHEBI:63726) |
| SB 203580 (CHEBI:90705) is a imidazoles (CHEBI:24780) |
| SB 203580 (CHEBI:90705) is a monofluorobenzenes (CHEBI:83575) |
| SB 203580 (CHEBI:90705) is a pyridines (CHEBI:26421) |
| SB 203580 (CHEBI:90705) is a sulfoxide (CHEBI:22063) |
| IUPAC Name |
|---|
| 4-{4-(4-fluorophenyl)-2-[4-(methanesulfinyl)phenyl]-1H-imidazol-5-yl}pyridine |
| Synonyms | Source |
|---|---|
| 4-(4-Fluorophenyl)-2-(4-methylsulfinylphenyl)-5-(4-pyridyl)-1H-imidazole | ChemIDplus |
| SB-203580 | ChemIDplus |
| SB203580 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0244686 | HMDB |
| LSM-1168 | LINCS |
| SB_203580 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8078222 | Reaxys |
| CAS:152121-47-6 | ChemIDplus |
| Citations |
|---|