EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16N2O4 |
| Net Charge | -1 |
| Average Mass | 276.292 |
| Monoisotopic Mass | 276.11156 |
| SMILES | CC1(C)N([O])C(c2ccc(C(=O)[O-])cc2)=[N+]([O-])C1(C)C |
| InChI | InChI=1S/C14H17N2O4/c1-13(2)14(3,4)16(20)11(15(13)19)9-5-7-10(8-6-9)12(17)18/h5-8H,1-4H3,(H,17,18)/p-1 |
| InChIKey | KWNDLWPKCDMGTN-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carboxylato-PTIO (CHEBI:90704) is a benzoates (CHEBI:22718) |
| carboxylato-PTIO (CHEBI:90704) is a radical anion (CHEBI:36873) |
| carboxylato-PTIO (CHEBI:90704) is conjugate base of carboxy-PTIO (CHEBI:90702) |
| Incoming Relation(s) |
| potassium 2-(4-carboxylatophenyl)-4,4,5,5-tetramethylimidazoline-1-oxyl-3-oxide (CHEBI:90701) has part carboxylato-PTIO (CHEBI:90704) |
| carboxy-PTIO (CHEBI:90702) is conjugate acid of carboxylato-PTIO (CHEBI:90704) |
| IUPAC Name |
|---|
| [2-(4-carboxylatophenyl)-4,4,5,5-tetramethyl-3-oxo-4,5-dihydro-1H-3λ5-imidazol-1-yl]oxidanyl |
| Synonyms | Source |
|---|---|
| carboxy-PTIO(1−) | ChEBI |
| carboxy-PTIO anion | ChEBI |