EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:30748 - 2,4-dichlorobenzoic acid
| Formula | C7H4Cl2O2 |
| Net Charge | 0 |
| Average Mass | 191.013 |
| Monoisotopic Mass | 189.95883 |
| SMILES | O=C(O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C7H4Cl2O2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,(H,10,11) |
| InChIKey | ATCRIUVQKHMXSH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fischerella ambigua (ncbitaxon:56108) | - | PubMed (15787461) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-dichlorobenzoic acid (CHEBI:30748) has functional parent benzoic acid (CHEBI:30746) |
| 2,4-dichlorobenzoic acid (CHEBI:30748) has role bacterial metabolite (CHEBI:76969) |
| 2,4-dichlorobenzoic acid (CHEBI:30748) is a chlorobenzoic acid (CHEBI:23134) |
| 2,4-dichlorobenzoic acid (CHEBI:30748) is a dichlorobenzene (CHEBI:23697) |
| 2,4-dichlorobenzoic acid (CHEBI:30748) is conjugate acid of 2,4-dichlorobenzoate (CHEBI:28995) |
| Incoming Relation(s) |
| 1-(2,4-dichlorobenzoyl)-1H-1,2,3-benzotriazole (CHEBI:75330) has functional parent 2,4-dichlorobenzoic acid (CHEBI:30748) |
| 1-(2,4-dichlorobenzoyl)-1H-benzimidazole (CHEBI:75333) has functional parent 2,4-dichlorobenzoic acid (CHEBI:30748) |
| 2,4-dichlorobenzoyl-CoA (CHEBI:15470) has functional parent 2,4-dichlorobenzoic acid (CHEBI:30748) |
| 2,4-dichlorobenzoate (CHEBI:28995) is conjugate base of 2,4-dichlorobenzoic acid (CHEBI:30748) |
| IUPAC Name |
|---|
| 2,4-dichlorobenzoic acid |
| Synonym | Source |
|---|---|
| 2,4-Dichlorobenzoic acid | KEGG COMPOUND |
| Citations |
|---|