EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H3Cl2O2 |
| Net Charge | -1 |
| Average Mass | 190.005 |
| Monoisotopic Mass | 188.95156 |
| SMILES | O=C([O-])c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C7H4Cl2O2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,(H,10,11)/p-1 |
| InChIKey | ATCRIUVQKHMXSH-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-dichlorobenzoate (CHEBI:28995) has functional parent benzoate (CHEBI:16150) |
| 2,4-dichlorobenzoate (CHEBI:28995) has role bacterial metabolite (CHEBI:76969) |
| 2,4-dichlorobenzoate (CHEBI:28995) is a chlorobenzoate (CHEBI:23133) |
| 2,4-dichlorobenzoate (CHEBI:28995) is conjugate base of 2,4-dichlorobenzoic acid (CHEBI:30748) |
| Incoming Relation(s) |
| 2,4-dichlorobenzoic acid (CHEBI:30748) is conjugate acid of 2,4-dichlorobenzoate (CHEBI:28995) |
| IUPAC Name |
|---|
| 2,4-dichlorobenzoate |
| Manual Xrefs | Databases |
|---|---|
| c0188 | UM-BBD |
| Registry Numbers | Sources |
|---|---|
| Gmelin:329290 | Gmelin |
| Reaxys:4135889 | Reaxys |