EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:90695 - anthra[1,9-cd]pyrazol-6(2H)-one
| Formula | C14H8N2O |
| Net Charge | 0 |
| Average Mass | 220.231 |
| Monoisotopic Mass | 220.06366 |
| SMILES | O=C1c2ccccc2-c2nnc3cccc1c23 |
| InChI | InChI=1S/C14H8N2O/c17-14-9-5-2-1-4-8(9)13-12-10(14)6-3-7-11(12)15-16-13/h1-7H,(H,15,16) |
| InChIKey | ACPOUJIDANTYHO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | c-Jun N-terminal kinase inhibitor An EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor that inhibits the action of c-Jun N-terminal kinase. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anthra[1,9-cd]pyrazol-6(2H)-one (CHEBI:90695) has role antineoplastic agent (CHEBI:35610) |
| anthra[1,9-cd]pyrazol-6(2H)-one (CHEBI:90695) has role c-Jun N-terminal kinase inhibitor (CHEBI:90172) |
| anthra[1,9-cd]pyrazol-6(2H)-one (CHEBI:90695) has role geroprotector (CHEBI:176497) |
| anthra[1,9-cd]pyrazol-6(2H)-one (CHEBI:90695) is a anthrapyrazole (CHEBI:90698) |
| anthra[1,9-cd]pyrazol-6(2H)-one (CHEBI:90695) is a aromatic ketone (CHEBI:76224) |
| anthra[1,9-cd]pyrazol-6(2H)-one (CHEBI:90695) is a cyclic ketone (CHEBI:3992) |
| IUPAC Name |
|---|
| dibenzo[cd,g]indazol-6(2H)-one |
| Synonyms | Source |
|---|---|
| SP 600125 | ChEBI |
| 1,9-Pyrazoloanthrone | ChemIDplus |
| C.I. 70300 | ChemIDplus |
| Pyrazolanthrone | ChemIDplus |
| Pyrazoleanthrone | ChemIDplus |
| 2H-dibenzo[cd,g]indazol-6-one | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 1,9-Pyrazoloanthrone | Wikipedia |
| LSM-1163 | LINCS |
| DB01782 | DrugBank |
| 537 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:746890 | Reaxys |
| CAS:129-56-6 | ChemIDplus |
| Citations |
|---|