EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H40N2O3 |
| Net Charge | 0 |
| Average Mass | 464.650 |
| Monoisotopic Mass | 464.30389 |
| SMILES | [H][C@@]12CC[C@]([H])(NCCCCCCN3C(=O)C=CC3=O)[C@@]1(C)CC[C@]1([H])c3ccc(OC)cc3CC[C@@]21[H] |
| InChI | InChI=1S/C29H40N2O3/c1-29-16-15-23-22-10-8-21(34-2)19-20(22)7-9-24(23)25(29)11-12-26(29)30-17-5-3-4-6-18-31-27(32)13-14-28(31)33/h8,10,13-14,19,23-26,30H,3-7,9,11-12,15-18H2,1-2H3/t23-,24-,25+,26+,29+/m1/s1 |
| InChIKey | LUFAORPFSVMJIW-ZRJUGLEFSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.1.4.11 (phosphoinositide phospholipase C) inhibitor An EC 3.1.4.* (phosphoric diester hydrolase) inhibitor that interferes with the action of phosphatidylinositol-specific phospholipase C (EC 3.1.4.11). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| U-73122 (CHEBI:90690) has functional parent 17β-estradiol (CHEBI:16469) |
| U-73122 (CHEBI:90690) has role EC 3.1.4.11 (phosphoinositide phospholipase C) inhibitor (CHEBI:64763) |
| U-73122 (CHEBI:90690) is a aromatic ether (CHEBI:35618) |
| U-73122 (CHEBI:90690) is a aza-steroid (CHEBI:35726) |
| U-73122 (CHEBI:90690) is a maleimides (CHEBI:55417) |
| IUPAC Name |
|---|
| 1-(6-{[(17β)-3-methoxyestra-1(10),2,4-trien-17-yl]amino}hexyl)-1H-pyrrole-2,5-dione |
| Synonyms | Source |
|---|---|
| U-73,122 | ChemIDplus |
| 1-(6-((3-Methoxyestra-1,3,5(10)-trien-17-yl)amino)hexyl)-1H-pyrrole-2,5-dione | ChemIDplus |
| U 73122 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8175101 | Reaxys |
| CAS:112648-68-7 | ChemIDplus |
| Citations |
|---|