EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H15ClN6O |
| Net Charge | 0 |
| Average Mass | 318.768 |
| Monoisotopic Mass | 318.09959 |
| SMILES | COc1c(C)cnc(Cn2cnc3c(Cl)nc(N)nc32)c1C |
| InChI | InChI=1S/C14H15ClN6O/c1-7-4-17-9(8(2)11(7)22-3)5-21-6-18-10-12(15)19-14(16)20-13(10)21/h4,6H,5H2,1-3H3,(H2,16,19,20) |
| InChIKey | QULDDKSCVCJTPV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | Hsp90 inhibitor An EC 3.6.4.10 (non-chaperonin molecular chaperone ATPase) inhibitor that blocks the action of heat shock protein 90. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BIIB021 (CHEBI:90687) has role antineoplastic agent (CHEBI:35610) |
| BIIB021 (CHEBI:90687) has role Hsp90 inhibitor (CHEBI:63962) |
| BIIB021 (CHEBI:90687) is a 2-aminopurines (CHEBI:20702) |
| BIIB021 (CHEBI:90687) is a aromatic ether (CHEBI:35618) |
| BIIB021 (CHEBI:90687) is a organochlorine compound (CHEBI:36683) |
| BIIB021 (CHEBI:90687) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| 6-chloro-9-[(4-methoxy-3,5-dimethylpyridin-2-yl)methyl]-9H-purin-2-amine |
| Synonyms | Source |
|---|---|
| BIIB-021 | ChemIDplus |
| CNF2024 | ChemIDplus |
| BIIB 021 | ChemIDplus |
| 94M | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11080986 | Reaxys |
| CAS:848695-25-0 | ChemIDplus |
| Citations |
|---|