EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H19N7O |
| Net Charge | 0 |
| Average Mass | 397.442 |
| Monoisotopic Mass | 397.16511 |
| SMILES | Cc1ccccc1-n1c(Cn2cnc3c(N)ncnc32)nc2cccc(C)c2c1=O |
| InChI | InChI=1S/C22H19N7O/c1-13-6-3-4-9-16(13)29-17(27-15-8-5-7-14(2)18(15)22(29)30)10-28-12-26-19-20(23)24-11-25-21(19)28/h3-9,11-12H,10H2,1-2H3,(H2,23,24,25) |
| InChIKey | GNWHRHGTIBRNSM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor An inhibitor of phosphatidylinositol 3-kinase, EC 2.7.1.137, a family of related enzymes capable of phosphorylating the 3 position hydroxy group of the inositol ring of a phosphatidylinositol. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| IC-87114 (CHEBI:90686) has role EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor (CHEBI:50914) |
| IC-87114 (CHEBI:90686) is a 6-aminopurines (CHEBI:20706) |
| IC-87114 (CHEBI:90686) is a biaryl (CHEBI:64459) |
| IC-87114 (CHEBI:90686) is a quinazolines (CHEBI:38530) |
| IUPAC Name |
|---|
| 2-[(6-amino-9H-purin-9-yl)methyl]-5-methyl-3-(2-methylphenyl)quinazolin-4(3H)-one |
| Synonyms | Source |
|---|---|
| IC 87114 | ChemIDplus |
| IC87114 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13928812 | Reaxys |
| CAS:371242-69-2 | ChemIDplus |
| Citations |
|---|