EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30ClFN4O3 |
| Net Charge | 0 |
| Average Mass | 513.013 |
| Monoisotopic Mass | 512.19905 |
| SMILES | C[C@@H]1CN(Cc2ccc(F)cc2)[C@@H](C)CN1C(=O)c1cc2c(C(=O)C(=O)N(C)C)cn(C)c2cc1Cl |
| InChI | InChI=1S/C27H30ClFN4O3/c1-16-13-33(17(2)12-32(16)14-18-6-8-19(29)9-7-18)26(35)21-10-20-22(25(34)27(36)30(3)4)15-31(5)24(20)11-23(21)28/h6-11,15-17H,12-14H2,1-5H3/t16-,17+/m0/s1 |
| InChIKey | ZMELOYOKMZBMRB-DLBZAZTESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of mitogen-activated protein kinase (EC 2.7.11.24). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| talmapimod (CHEBI:90683) has role antineoplastic agent (CHEBI:35610) |
| talmapimod (CHEBI:90683) has role apoptosis inducer (CHEBI:68495) |
| talmapimod (CHEBI:90683) has role EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor (CHEBI:79091) |
| talmapimod (CHEBI:90683) is a N-acylpiperazine (CHEBI:46844) |
| talmapimod (CHEBI:90683) is a N-alkylpiperazine (CHEBI:46845) |
| talmapimod (CHEBI:90683) is a aromatic amide (CHEBI:62733) |
| talmapimod (CHEBI:90683) is a aromatic ketone (CHEBI:76224) |
| talmapimod (CHEBI:90683) is a chloroindole (CHEBI:52508) |
| talmapimod (CHEBI:90683) is a dicarboxylic acid diamide (CHEBI:35779) |
| talmapimod (CHEBI:90683) is a indolecarboxamide (CHEBI:46921) |
| talmapimod (CHEBI:90683) is a monofluorobenzenes (CHEBI:83575) |
| IUPAC Name |
|---|
| 2-(6-chloro-5-{(2R,5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazine-1-carbonyl}-1-methyl-1H-indol-3-yl)-N,N-dimethyl-2-oxoacetamide |
| INN | Source |
|---|---|
| talmapimod | KEGG DRUG |
| Synonyms | Source |
|---|---|
| SCIO 469 | ChemIDplus |
| SCIO-469 | ChemIDplus |
| SCIO469 | ChEBI |
| Scios 469 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11328447 | Reaxys |
| CAS:309913-83-5 | ChemIDplus |
| CAS:309913-83-5 | KEGG DRUG |
| Citations |
|---|