EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H15F3N4O |
| Net Charge | 0 |
| Average Mass | 432.405 |
| Monoisotopic Mass | 432.11980 |
| SMILES | Nc1ccc(-c2ccc3ncc4ccc(=O)n(-c5cccc(C(F)(F)F)c5)c4c3c2)cn1 |
| InChI | InChI=1S/C24H15F3N4O/c25-24(26,27)17-2-1-3-18(11-17)31-22(32)9-6-16-13-29-20-7-4-14(10-19(20)23(16)31)15-5-8-21(28)30-12-15/h1-13H,(H2,28,30) |
| InChIKey | GUXXEUUYCAYESJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | mTOR inhibitor A protein kinase inhibitor of the mammalian target of rapamycin (mTOR), a protein that regulates cell growth, cell proliferation, cell motility, cell survival, protein synthesis and transcription. mTOR inhibitors are used to prevent transplant rejection and in treatment of cancer. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| torin 2 (CHEBI:90682) has role antineoplastic agent (CHEBI:35610) |
| torin 2 (CHEBI:90682) has role mTOR inhibitor (CHEBI:68481) |
| torin 2 (CHEBI:90682) is a aminopyridine (CHEBI:38207) |
| torin 2 (CHEBI:90682) is a organofluorine compound (CHEBI:37143) |
| torin 2 (CHEBI:90682) is a primary amino compound (CHEBI:50994) |
| torin 2 (CHEBI:90682) is a pyridoquinoline (CHEBI:38921) |
| IUPAC Name |
|---|
| 9-(6-aminopyridin-3-yl)-1-[3-(trifluoromethyl)phenyl]benzo[h][1,6]naphthyridin-2(1H)-one |
| Synonym | Source |
|---|---|
| torin2 | ChEBI |
| Citations |
|---|