EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16N6O |
| Net Charge | 0 |
| Average Mass | 308.345 |
| Monoisotopic Mass | 308.13856 |
| SMILES | CC(C)n1nc(-c2cc3cc(O)ccc3n2)c2c(N)ncnc21 |
| InChI | InChI=1S/C16H16N6O/c1-8(2)22-16-13(15(17)18-7-19-16)14(21-22)12-6-9-5-10(23)3-4-11(9)20-12/h3-8,20,23H,1-2H3,(H2,17,18,19) |
| InChIKey | MFAQYJIYDMLAIM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | mTOR inhibitor A protein kinase inhibitor of the mammalian target of rapamycin (mTOR), a protein that regulates cell growth, cell proliferation, cell motility, cell survival, protein synthesis and transcription. mTOR inhibitors are used to prevent transplant rejection and in treatment of cancer. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| torkinib (CHEBI:90679) has role antineoplastic agent (CHEBI:35610) |
| torkinib (CHEBI:90679) has role mTOR inhibitor (CHEBI:68481) |
| torkinib (CHEBI:90679) is a aromatic amine (CHEBI:33860) |
| torkinib (CHEBI:90679) is a biaryl (CHEBI:64459) |
| torkinib (CHEBI:90679) is a hydroxyindoles (CHEBI:84729) |
| torkinib (CHEBI:90679) is a phenols (CHEBI:33853) |
| torkinib (CHEBI:90679) is a primary amino compound (CHEBI:50994) |
| torkinib (CHEBI:90679) is a pyrazolopyrimidine (CHEBI:38669) |
| IUPAC Name |
|---|
| 2-[4-amino-1-(propan-2-yl)-1H-pyrazolo[3,4-d]pyrimidin-3-yl]-1H-indol-5-ol |
| Synonyms | Source |
|---|---|
| PP242 | ChemIDplus |
| PP-242 | ChemIDplus |
| PP 242 | ChEBI |
| 2-(4-Amino-1-isopropyl-1H-pyrazolo(3,4-d)pyrimidin-3-yl)-1H-indol-5-ol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| P2X | PDBeChem |
| HMDB0060607 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11730137 | Reaxys |
| CAS:1092351-67-1 | ChemIDplus |
| Citations |
|---|