EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H27N7O3 |
| Net Charge | 0 |
| Average Mass | 425.493 |
| Monoisotopic Mass | 425.21754 |
| SMILES | CCn1c(-c2nonc2N)nc2c(C#CC(C)(C)O)ncc(OC[C@H]3CCCNC3)c21 |
| InChI | InChI=1S/C21H27N7O3/c1-4-28-18-15(30-12-13-6-5-9-23-10-13)11-24-14(7-8-21(2,3)29)16(18)25-20(28)17-19(22)27-31-26-17/h11,13,23,29H,4-6,9-10,12H2,1-3H3,(H2,22,27)/t13-/m0/s1 |
| InChIKey | KGPGFQWBCSZGEL-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of non-specific serine/threonine protein kinase (EC 2.7.11.1), a kinase enzyme involved in phosphorylation of hydroxy group of serine or threonine. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GSK690693 (CHEBI:90677) has role antineoplastic agent (CHEBI:35610) |
| GSK690693 (CHEBI:90677) has role EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor (CHEBI:50925) |
| GSK690693 (CHEBI:90677) is a 1,2,5-oxadiazole (CHEBI:46815) |
| GSK690693 (CHEBI:90677) is a acetylenic compound (CHEBI:73474) |
| GSK690693 (CHEBI:90677) is a aromatic amine (CHEBI:33860) |
| GSK690693 (CHEBI:90677) is a aromatic ether (CHEBI:35618) |
| GSK690693 (CHEBI:90677) is a imidazopyridine (CHEBI:46908) |
| GSK690693 (CHEBI:90677) is a piperidines (CHEBI:26151) |
| GSK690693 (CHEBI:90677) is a primary amino compound (CHEBI:50994) |
| GSK690693 (CHEBI:90677) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| 4-[2-(4-amino-1,2,5-oxadiazol-3-yl)-1-ethyl-7-{[(3S)-piperidin-3-yl]methoxy}-1H-imidazo[4,5-c]pyridin-4-yl]-2-methylbut-3-yn-2-ol |
| Synonyms | Source |
|---|---|
| GSK 690693 | ChemIDplus |
| GSK-690693 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| G93 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18301457 | Reaxys |
| CAS:937174-76-0 | ChemIDplus |
| Citations |
|---|