EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H23N6O5Se |
| Net Charge | +1 |
| Average Mass | 446.346 |
| Monoisotopic Mass | 447.08897 |
| SMILES | C[Se+](CC[C@H](N)C(=O)O)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H22N6O5Se/c1-27(3-2-7(16)15(24)25)4-8-10(22)11(23)14(26-8)21-6-20-9-12(17)18-5-19-13(9)21/h5-8,10-11,14,22-23H,2-4,16H2,1H3,(H2-,17,18,19,24,25)/p+1/t7-,8+,10+,11+,14+,27?/m0/s1 |
| InChIKey | GGJFWMOVUFBSIN-AIRLBKTGSA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-adenosylselenomethionine (CHEBI:9066) has role mouse metabolite (CHEBI:75771) |
| L-adenosylselenomethionine (CHEBI:9066) is a adenosines (CHEBI:22260) |
| L-adenosylselenomethionine (CHEBI:9066) is a organic cation (CHEBI:25697) |
| L-adenosylselenomethionine (CHEBI:9066) is a selenomethionines (CHEBI:26640) |
| L-adenosylselenomethionine (CHEBI:9066) is tautomer of L-adenosylselenomethionine zwitterion (CHEBI:62227) |
| Incoming Relation(s) |
| L-adenosylselenomethionine zwitterion (CHEBI:62227) is tautomer of L-adenosylselenomethionine (CHEBI:9066) |
| IUPAC Name |
|---|
| [(3S)-3-amino-3-carboxypropyl](5'-deoxyadenosin-5'-yl)(methyl)selenonium |
| Synonyms | Source |
|---|---|
| Se-adenosyl-L-selenomethionine | ChEBI |
| Se-Adenosylselenomethionine | KEGG COMPOUND |
| Citations |
|---|