EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12HF23O2 |
| Net Charge | 0 |
| Average Mass | 614.092 |
| Monoisotopic Mass | 613.96093 |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12HF23O2/c13-2(14,1(36)37)3(15,16)4(17,18)5(19,20)6(21,22)7(23,24)8(25,26)9(27,28)10(29,30)11(31,32)12(33,34)35/h(H,36,37) |
| InChIKey | CXGONMQFMIYUJR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perfluorododecanoic acid (CHEBI:90633) has functional parent dodecanoic acid (CHEBI:30805) |
| perfluorododecanoic acid (CHEBI:90633) has role environmental contaminant (CHEBI:78298) |
| perfluorododecanoic acid (CHEBI:90633) is a fluoroalkanoic acid (CHEBI:35551) |
| IUPAC Name |
|---|
| tricosafluorododecanoic acid |
| Synonyms | Source |
|---|---|
| 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecanoic acid | ChemIDplus |
| C11F23COOH | ChEBI |
| C11F23CO2H | ChEBI |
| n-C11F23COOH | ChEBI |
| n-C11F23CO2H | ChEBI |
| perfluorolauric acid | ChemIDplus |
| Citations |
|---|