EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C20H38N6O4.H2O4S |
| Net Charge | 0 |
| Average Mass | 951.203 |
| Monoisotopic Mass | 950.55829 |
| SMILES | O=S(=O)(O)O.[H]C(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(C)=O.[H]C(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(C)=O |
| InChI | InChI=1S/2C20H38N6O4.H2O4S/c2*1-12(2)9-16(24-14(5)28)19(30)26-17(10-13(3)4)18(29)25-15(11-27)7-6-8-23-20(21)22;1-5(2,3)4/h2*11-13,15-17H,6-10H2,1-5H3,(H,24,28)(H,25,29)(H,26,30)(H4,21,22,23);(H2,1,2,3,4)/t2*15-,16-,17-;/m00./s1 |
| InChIKey | CIPMKIHUGVGQTG-VFFZMTJFSA-N |
| Roles Classification |
|---|
| Biological Roles: | calpain inhibitor An EC 3.4.22.* (cysteine endopeptidase) inhibitor that interferes with the action of any calpain. EC 3.4.21.4 (trypsin) inhibitor An EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of trypsin (EC 3.4.21.4). cathepsin B inhibitor A cysteine protease inhibitor which inhibits cathepsin B (EC 3.4.22.1). serine protease inhibitor Any protease inhibitor that restricts the action of a serine protease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| leupeptin hemisulfate (CHEBI:90629) has role calpain inhibitor (CHEBI:82824) |
| leupeptin hemisulfate (CHEBI:90629) has role cathepsin B inhibitor (CHEBI:64932) |
| leupeptin hemisulfate (CHEBI:90629) has role EC 3.4.21.4 (trypsin) inhibitor (CHEBI:76940) |
| leupeptin hemisulfate (CHEBI:90629) has role serine protease inhibitor (CHEBI:64926) |
| leupeptin hemisulfate (CHEBI:90629) is a peptide sulfate salt (CHEBI:38019) |
| IUPAC Names |
|---|
| bis{N-acetyl-L-leucyl-N-[(2S)-5-{[azaniumyl(imino)methyl]amino}-1-oxopentan-2-yl]-L-leucinamide} sulfate |
| N-acetyl-L-leucyl-N-[(2S)-5-carbamimidamido-1-oxopentan-2-yl]-L-leucinamide sulfate (2:1) |
| Synonyms | Source |
|---|---|
| Leupeptin hemisulfate anhydrous | ChemIDplus |
| leupeptin sulfate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:103476-89-7 | ChemIDplus |