EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H17N5O2 |
| Net Charge | 0 |
| Average Mass | 383.411 |
| Monoisotopic Mass | 383.13822 |
| SMILES | COc1ccc2c(OCc3nnc4ccc(-c5ccccc5)nn34)ccnc2c1 |
| InChI | InChI=1S/C22H17N5O2/c1-28-16-7-8-17-19(13-16)23-12-11-20(17)29-14-22-25-24-21-10-9-18(26-27(21)22)15-5-3-2-4-6-15/h2-13H,14H2,1H3 |
| InChIKey | HEAIZQNMNCHNFD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | c-Met tyrosine kinase inhibitor An EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor that interferes with the action of c-Met tyrosine kinase. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AMG-208 (CHEBI:90626) has role antineoplastic agent (CHEBI:35610) |
| AMG-208 (CHEBI:90626) has role c-Met tyrosine kinase inhibitor (CHEBI:90199) |
| AMG-208 (CHEBI:90626) is a aromatic ether (CHEBI:35618) |
| AMG-208 (CHEBI:90626) is a quinolines (CHEBI:26513) |
| AMG-208 (CHEBI:90626) is a triazolopyridazine (CHEBI:48384) |
| IUPAC Name |
|---|
| 7-methoxy-4-[(6-phenyl[1,2,4]triazolo[4,3-b]pyridazin-3-yl)methoxy]quinoline |
| Synonyms | Source |
|---|---|
| AMG 208 | ChEBI |
| AMG208 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1002304-34-8 | ChemIDplus |
| Citations |
|---|