EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H13N7S |
| Net Charge | 0 |
| Average Mass | 359.418 |
| Monoisotopic Mass | 359.09531 |
| SMILES | Cn1cc(-c2ccc3nnc(Sc4ccc5ncccc5c4)n3n2)cn1 |
| InChI | InChI=1S/C18H13N7S/c1-24-11-13(10-20-24)16-6-7-17-21-22-18(25(17)23-16)26-14-4-5-15-12(9-14)3-2-8-19-15/h2-11H,1H3 |
| InChIKey | BCZUAADEACICHN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | c-Met tyrosine kinase inhibitor An EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor that interferes with the action of c-Met tyrosine kinase. nephrotoxic agent A role played by any chemical compound (natural or synthetic) exhibiting itself through the ability to induce damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SGX-523 (CHEBI:90624) has role c-Met tyrosine kinase inhibitor (CHEBI:90199) |
| SGX-523 (CHEBI:90624) has role nephrotoxic agent (CHEBI:50909) |
| SGX-523 (CHEBI:90624) is a aryl sulfide (CHEBI:35683) |
| SGX-523 (CHEBI:90624) is a biaryl (CHEBI:64459) |
| SGX-523 (CHEBI:90624) is a pyrazoles (CHEBI:26410) |
| SGX-523 (CHEBI:90624) is a quinolines (CHEBI:26513) |
| SGX-523 (CHEBI:90624) is a triazolopyridazine (CHEBI:48384) |
| IUPAC Name |
|---|
| 6-{[6-(1-methyl-1H-pyrazol-4-yl)[1,2,4]triazolo[4,3-b]pyridazin-3-yl]sulfanyl}quinoline |
| Synonyms | Source |
|---|---|
| SGX-523 | ChemIDplus |
| SGX523 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18321133 | Reaxys |
| CAS:1022150-57-7 | ChemIDplus |
| Citations |
|---|