EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18O8 |
| Net Charge | 0 |
| Average Mass | 374.345 |
| Monoisotopic Mass | 374.10017 |
| SMILES | COc1cccc(O)c1-c1cc(=O)c2c(O)c(OC)c(OC)c(OC)c2o1 |
| InChI | InChI=1S/C19H18O8/c1-23-11-7-5-6-9(20)13(11)12-8-10(21)14-15(22)17(24-2)19(26-4)18(25-3)16(14)27-12/h5-8,20,22H,1-4H3 |
| InChIKey | GMQFOKBGMKVUQZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Scutellaria baicalensis (ncbitaxon:65409) | - | PubMed (22314230) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 1.6.5.2 [NAD(P)H dehydrogenase (quinone)] inhibitor An EC 1.6.5.* (oxidoreductase acting on NADH or NADPH with a quinone or similar as acceptor) inhibitor that interferes with the action of NAD(P)H dehydrogenase (quinone), EC 1.6.5.2. |
| Application: | anti-asthmatic drug A drug used to treat asthma. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| scullcapflavone II (CHEBI:9061) has functional parent flavone (CHEBI:42491) |
| scullcapflavone II (CHEBI:9061) has role anti-asthmatic drug (CHEBI:49167) |
| scullcapflavone II (CHEBI:9061) has role EC 1.6.5.2 [NAD(P)H dehydrogenase (quinone)] inhibitor (CHEBI:50390) |
| scullcapflavone II (CHEBI:9061) has role plant metabolite (CHEBI:76924) |
| scullcapflavone II (CHEBI:9061) is a dihydroxyflavone (CHEBI:38686) |
| scullcapflavone II (CHEBI:9061) is a tetramethoxyflavone (CHEBI:76875) |
| IUPAC Name |
|---|
| 5-hydroxy-2-(2-hydroxy-6-methoxyphenyl)-6,7,8-trimethoxy-4H-1-benzopyran-4-one |
| Synonyms | Source |
|---|---|
| 5,2'-dihydroxy-6,7,8,6'-tetramethoxyflavone | ChEBI |
| 5-hydroxy-2-(2-hydroxy-6-methoxy-phenyl)-6,7,8-trimethoxy-chromen-4-one | ChEBI |
| neobaicalein | KNApSAcK |
| skullcapflavone II | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| C00001099 | KNApSAcK |
| C10183 | KEGG COMPOUND |
| LMPK12111423 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3634558 | Reaxys |
| CAS:55084-08-7 | KEGG COMPOUND |
| CAS:55084-08-7 | ChemIDplus |
| Citations |
|---|