EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30NO2S |
| Net Charge | 0 |
| Average Mass | 324.510 |
| Monoisotopic Mass | 324.19973 |
| SMILES | *N[C@@H](CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(=O)O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-[(2E,6E)-farnesyl]-L-cysteino group (CHEBI:90595) is a L-α-amino acid residue (CHEBI:83228) |
| S-[(2E,6E)-farnesyl]-L-cysteino group (CHEBI:90595) is conjugate acid of S-[(2E,6E)-farnesyl]-L-cysteinate residue (CHEBI:90510) |
| S-[(2E,6E)-farnesyl]-L-cysteino group (CHEBI:90595) is substituent group from S-[(2E,6E)-farnesyl]-L-cysteine (CHEBI:62197) |
| Incoming Relation(s) |
| S-[(2E,6E)-farnesyl]-L-cysteinate residue (CHEBI:90510) is conjugate base of S-[(2E,6E)-farnesyl]-L-cysteino group (CHEBI:90595) |