EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H16N |
| Net Charge | +1 |
| Average Mass | 114.212 |
| Monoisotopic Mass | 114.12773 |
| SMILES | C[N+]1(C)CCCCC1 |
| InChI | InChI=1S/C7H16N/c1-8(2)6-4-3-5-7-8/h3-7H2,1-2H3/q+1 |
| InChIKey | NNCAWEWCFVZOGF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Maillard reaction product Any thermal degradation product obtained as a result of a chemical reaction between an amino acid and a reducing sugar (Maillard reaction, a non-enzymatic browning procedure that usually imparts flavour to starch-based food products). |
| Biological Role: | |
| Application: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mepiquat (CHEBI:90548) has role agrochemical (CHEBI:33286) |
| mepiquat (CHEBI:90548) has role Maillard reaction product (CHEBI:77523) |
| mepiquat (CHEBI:90548) has role plant growth retardant (CHEBI:35219) |
| mepiquat (CHEBI:90548) is a quaternary ammonium ion (CHEBI:35267) |
| Incoming Relation(s) |
| mepiquat chloride (CHEBI:81772) has part mepiquat (CHEBI:90548) |
| IUPAC Name |
|---|
| 1,1-dimethylpiperidinium |
| Synonyms | Source |
|---|---|
| 1,1-dimethylpiperidin-1-ium | Alan Wood's Pesticides |
| 1,1-dimethylpiperidinium ion | ChemIDplus |
| N,N-dimethylpiperidinium | ChEBI |
| mépiquat | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1421549 | Reaxys |
| CAS:15302-91-7 | Alan Wood's Pesticides |
| CAS:15302-91-7 | ChemIDplus |
| Citations |
|---|