EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21F2N7O2 |
| Net Charge | 0 |
| Average Mass | 417.420 |
| Monoisotopic Mass | 417.17248 |
| SMILES | FC(F)c1nc2ccccc2n1-c1nc(N2CCOCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C19H21F2N7O2/c20-15(21)16-22-13-3-1-2-4-14(13)28(16)19-24-17(26-5-9-29-10-6-26)23-18(25-19)27-7-11-30-12-8-27/h1-4,15H,5-12H2 |
| InChIKey | HGVNLRPZOWWDKD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor An inhibitor of phosphatidylinositol 3-kinase, EC 2.7.1.137, a family of related enzymes capable of phosphorylating the 3 position hydroxy group of the inositol ring of a phosphatidylinositol. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ZSTK-474 (CHEBI:90545) has role antineoplastic agent (CHEBI:35610) |
| ZSTK-474 (CHEBI:90545) has role EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor (CHEBI:50914) |
| ZSTK-474 (CHEBI:90545) is a benzimidazoles (CHEBI:22715) |
| ZSTK-474 (CHEBI:90545) is a morpholines (CHEBI:38785) |
| ZSTK-474 (CHEBI:90545) is a organofluorine compound (CHEBI:37143) |
| ZSTK-474 (CHEBI:90545) is a triamino-1,3,5-triazine (CHEBI:38175) |
| IUPAC Name |
|---|
| 1-[4,6-bis(morpholin-4-yl)-1,3,5-triazin-2-yl]-2-(difluoromethyl)-1H-benzimidazole |
| Synonyms | Source |
|---|---|
| 2-(2-difluoromethylbenzimidazol-1-yl)-4,6-bis(morpholino)-1,3,5-triazine | ChemIDplus |
| 2-(2-difluoromethylbenzimidazol-1-yl)-4,6-dimorpholino-1,3,5-triazine | ChEBI |
| 2-(difluoromethyl)-1-[4,6-di(4-morpholinyl)-1,3,5-triazin-2-yl]-1H-benzimidazole | ChEBI |
| 4,4'-(6-(2-(difluoromethyl)-1H-benzo[d]imidazol-1-yl)-1,3,5-triazine-2,4-diyl)dimorpholine | ChEBI |
| ZSTK 474 | ChemIDplus |
| ZSTK474 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11677260 | Reaxys |
| CAS:475110-96-4 | ChemIDplus |
| Citations |
|---|