EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H11NO3S2 |
| Net Charge | 0 |
| Average Mass | 281.358 |
| Monoisotopic Mass | 281.01804 |
| SMILES | COC(=O)c1sccc1NC(=O)Cc1cccs1 |
| InChI | InChI=1S/C12H11NO3S2/c1-16-12(15)11-9(4-6-18-11)13-10(14)7-8-3-2-5-17-8/h2-6H,7H2,1H3,(H,13,14) |
| InChIKey | CXOCENPNQSXLGZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | c-Jun N-terminal kinase inhibitor An EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor that inhibits the action of c-Jun N-terminal kinase. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl 3-[2-(2-thienyl)acetamido]thiophene-2-carboxylate (CHEBI:90543) has functional parent 2-thienylacetic acid (CHEBI:45807) |
| methyl 3-[2-(2-thienyl)acetamido]thiophene-2-carboxylate (CHEBI:90543) has role c-Jun N-terminal kinase inhibitor (CHEBI:90172) |
| methyl 3-[2-(2-thienyl)acetamido]thiophene-2-carboxylate (CHEBI:90543) is a methyl ester (CHEBI:25248) |
| methyl 3-[2-(2-thienyl)acetamido]thiophene-2-carboxylate (CHEBI:90543) is a secondary carboxamide (CHEBI:140325) |
| methyl 3-[2-(2-thienyl)acetamido]thiophene-2-carboxylate (CHEBI:90543) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| methyl 3-[2-(2-thienyl)acetamido]thiophene-2-carboxylate |
| Synonym | Source |
|---|---|
| SYY | PDBeChem |
| Manual Xrefs | Databases |
|---|---|
| SYY | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21031790 | Reaxys |
| Citations |
|---|