EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H13ClN2O3S |
| Net Charge | 0 |
| Average Mass | 348.811 |
| Monoisotopic Mass | 348.03354 |
| SMILES | CCOc1ccc(-c2snnc2-c2cc(Cl)c(O)cc2O)cc1 |
| InChI | InChI=1S/C16H13ClN2O3S/c1-2-22-10-5-3-9(4-6-10)16-15(18-19-23-16)11-7-12(17)14(21)8-13(11)20/h3-8,20-21H,2H2,1H3 |
| InChIKey | RFRZSMIYYCXYNL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | Hsp90 inhibitor An EC 3.6.4.10 (non-chaperonin molecular chaperone ATPase) inhibitor that blocks the action of heat shock protein 90. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ICPD-47 (CHEBI:90538) has role Hsp90 inhibitor (CHEBI:63962) |
| ICPD-47 (CHEBI:90538) is a aromatic ether (CHEBI:35618) |
| ICPD-47 (CHEBI:90538) is a monochlorobenzenes (CHEBI:83403) |
| ICPD-47 (CHEBI:90538) is a resorcinols (CHEBI:33572) |
| ICPD-47 (CHEBI:90538) is a thiadiazoles (CHEBI:38099) |
| IUPAC Name |
|---|
| 4-chloro-6-[5-(4-ethoxyphenyl)-1,2,3-thiadiazol-4-yl]benzene-1,3-diol |
| Synonyms | Source |
|---|---|
| ICPD47 | ChEBI |
| ICPD 47 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| BZ8 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19357826 | Reaxys |
| Citations |
|---|