EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H27N3O3S |
| Net Charge | 0 |
| Average Mass | 533.653 |
| Monoisotopic Mass | 533.17731 |
| SMILES | Cc1cc(C(=C2C=CC(=Nc3ccccc3)C=C2)c2ccc(Nc3ccccc3S(=O)(=O)O)cc2)ccc1N |
| InChI | InChI=1S/C32H27N3O3S/c1-22-21-25(15-20-29(22)33)32(23-11-16-27(17-12-23)34-26-7-3-2-4-8-26)24-13-18-28(19-14-24)35-30-9-5-6-10-31(30)39(36,37)38/h2-21,35H,33H2,1H3,(H,36,37,38)/b32-23-,34-27+ |
| InChIKey | VOMZUJSUTZAURW-TXEARYQUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alkali Blue G (CHEBI:90532) has role fluorochrome (CHEBI:51217) |
| alkali Blue G (CHEBI:90532) has role histological dye (CHEBI:77178) |
| alkali Blue G (CHEBI:90532) is a aminobenzenesulfonic acid (CHEBI:33557) |
| alkali Blue G (CHEBI:90532) is a imine (CHEBI:24783) |
| alkali Blue G (CHEBI:90532) is a olefinic compound (CHEBI:78840) |
| alkali Blue G (CHEBI:90532) is a substituted aniline (CHEBI:48975) |
| alkali Blue G (CHEBI:90532) is conjugate acid of 2-(4-{(4-amino-3-methylphenyl)[4-(phenylimino)cyclohexa-2,5-dien-1-ylidene]methyl}anilino)benzene-1-sulfonate (CHEBI:90534) |
| Incoming Relation(s) |
| 2-(4-{(4-amino-3-methylphenyl)[4-(phenylimino)cyclohexa-2,5-dien-1-ylidene]methyl}anilino)benzene-1-sulfonate (CHEBI:90534) is conjugate base of alkali Blue G (CHEBI:90532) |
| IUPAC Name |
|---|
| 2-(4-{(4-amino-3-methylphenyl)[4-(phenylimino)cyclohexa-2,5-dien-1-ylidene]methyl}anilino)benzene-1-sulfonic acid |
| Synonyms | Source |
|---|---|
| ((4-((4-Amino-m-tolyl)(4-(phenylimino)cyclohexa-2,5-dien-1-ylidene)methyl)phenyl)amino)benzenesulphonic acid | ChemIDplus |
| alkali blue 4B (acid from) | ChEBI |
| alkali blue 4B free acid | ChEBI |
| C.I. Pigment Blue 19 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:58569-23-6 | ChemIDplus |