EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H23FN6O |
| Net Charge | 0 |
| Average Mass | 418.476 |
| Monoisotopic Mass | 418.19174 |
| SMILES | COc1ccc(Nc2ncc3nc(Nc4ccccc4F)n(C4CCCC4)c3n2)cc1 |
| InChI | InChI=1S/C23H23FN6O/c1-31-17-12-10-15(11-13-17)26-22-25-14-20-21(29-22)30(16-6-2-3-7-16)23(28-20)27-19-9-5-4-8-18(19)24/h4-5,8-14,16H,2-3,6-7H2,1H3,(H,27,28)(H,25,26,29) |
| InChIKey | IMFVPVKPQOQCBY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | c-Jun N-terminal kinase inhibitor An EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor that inhibits the action of c-Jun N-terminal kinase. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-cyclopentyl-N8-(2-fluorophenyl)-N2-(4-methoxyphenyl)-9H-purine-2,8-diamine (CHEBI:90530) has role c-Jun N-terminal kinase inhibitor (CHEBI:90172) |
| 9-cyclopentyl-N8-(2-fluorophenyl)-N2-(4-methoxyphenyl)-9H-purine-2,8-diamine (CHEBI:90530) is a cyclopentanes (CHEBI:23493) |
| 9-cyclopentyl-N8-(2-fluorophenyl)-N2-(4-methoxyphenyl)-9H-purine-2,8-diamine (CHEBI:90530) is a monofluorobenzenes (CHEBI:83575) |
| 9-cyclopentyl-N8-(2-fluorophenyl)-N2-(4-methoxyphenyl)-9H-purine-2,8-diamine (CHEBI:90530) is a monomethoxybenzene (CHEBI:25235) |
| 9-cyclopentyl-N8-(2-fluorophenyl)-N2-(4-methoxyphenyl)-9H-purine-2,8-diamine (CHEBI:90530) is a purines (CHEBI:26401) |
| 9-cyclopentyl-N8-(2-fluorophenyl)-N2-(4-methoxyphenyl)-9H-purine-2,8-diamine (CHEBI:90530) is a secondary amino compound (CHEBI:50995) |
| 9-cyclopentyl-N8-(2-fluorophenyl)-N2-(4-methoxyphenyl)-9H-purine-2,8-diamine (CHEBI:90530) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 9-cyclopentyl-N8-(2-fluorophenyl)-N2-(4-methoxyphenyl)-9H-purine-2,8-diamine |
| Manual Xrefs | Databases |
|---|---|
| JBI | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12671863 | Reaxys |
| Citations |
|---|