EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H36O2 |
| Net Charge | 0 |
| Average Mass | 308.506 |
| Monoisotopic Mass | 308.27153 |
| SMILES | [H][C@@]12CC[C@@](C)(O)[C@H](CC[C@@](C)(O)C=C)[C@@]1(C)CCCC2(C)C |
| InChI | InChI=1S/C20H36O2/c1-7-18(4,21)13-9-16-19(5)12-8-11-17(2,3)15(19)10-14-20(16,6)22/h7,15-16,21-22H,1,8-14H2,2-6H3/t15-,16+,18-,19-,20+/m0/s1 |
| InChIKey | XVULBTBTFGYVRC-HHUCQEJWSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sclareol (CHEBI:9053) has role antifungal agent (CHEBI:35718) |
| sclareol (CHEBI:9053) has role antimicrobial agent (CHEBI:33281) |
| sclareol (CHEBI:9053) has role apoptosis inducer (CHEBI:68495) |
| sclareol (CHEBI:9053) has role fragrance (CHEBI:48318) |
| sclareol (CHEBI:9053) has role plant metabolite (CHEBI:76924) |
| sclareol (CHEBI:9053) is a labdane diterpenoid (CHEBI:36770) |
| IUPAC Names |
|---|
| (1R,2R,4aS,8aS)-1-[(3R)-3-hydroxy-3-methylpent-4-en-1-yl]-2,5,5,8a-tetramethyldecahydronaphthalen-2-ol |
| labd-14-ene-8,13-diol |
| Synonym | Source |
|---|---|
| (13R)-Labd-14-ene-8,13-diol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| sclareol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00000894 | KNApSAcK |
| C09183 | KEGG COMPOUND |
| HMDB0036827 | HMDB |
| Sclareol | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2054148 | Reaxys |
| CAS:515-03-7 | KEGG COMPOUND |
| CAS:515-03-7 | ChemIDplus |
| Citations |
|---|