EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H36O2 |
| Net Charge | 0 |
| Average Mass | 308.506 |
| Monoisotopic Mass | 308.27153 |
| SMILES | [H][C@@]12CC[C@@](C)(O)[C@H](CC[C@@](C)(O)C=C)[C@@]1(C)CCCC2(C)C |
| InChI | InChI=1S/C20H36O2/c1-7-18(4,21)13-9-16-19(5)12-8-11-17(2,3)15(19)10-14-20(16,6)22/h7,15-16,21-22H,1,8-14H2,2-6H3/t15-,16+,18-,19-,20+/m0/s1 |
| InChIKey | XVULBTBTFGYVRC-HHUCQEJWSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sclareol (CHEBI:9053) has role antifungal agent (CHEBI:35718) |
| sclareol (CHEBI:9053) has role antimicrobial agent (CHEBI:33281) |
| sclareol (CHEBI:9053) has role apoptosis inducer (CHEBI:68495) |
| sclareol (CHEBI:9053) has role fragrance (CHEBI:48318) |
| sclareol (CHEBI:9053) has role plant metabolite (CHEBI:76924) |
| sclareol (CHEBI:9053) is a labdane diterpenoid (CHEBI:36770) |
| IUPAC Names |
|---|
| (1R,2R,4aS,8aS)-1-[(3R)-3-hydroxy-3-methylpent-4-en-1-yl]-2,5,5,8a-tetramethyldecahydronaphthalen-2-ol |
| labd-14-ene-8,13-diol |
| Synonym | Source |
|---|---|
| (13R)-Labd-14-ene-8,13-diol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| sclareol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00000894 | KNApSAcK |
| C09183 | KEGG COMPOUND |
| HMDB0036827 | HMDB |
| Sclareol | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2054148 | Reaxys |
| CAS:515-03-7 | KEGG COMPOUND |
| CAS:515-03-7 | ChemIDplus |
| Citations |
|---|