EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H9Cl2F2N3OS |
| Net Charge | 0 |
| Average Mass | 436.270 |
| Monoisotopic Mass | 434.98114 |
| SMILES | O=c1ncn2nc(Sc3ccc(F)cc3F)ccc2c1-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C19H9Cl2F2N3OS/c20-11-2-1-3-12(21)17(11)18-14-5-7-16(25-26(14)9-24-19(18)27)28-15-6-4-10(22)8-13(15)23/h1-9H |
| InChIKey | VEPKQEUBKLEPRA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of mitogen-activated protein kinase (EC 2.7.11.24). |
| Application: | anti-inflammatory drug A substance that reduces or suppresses inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| VX-745 (CHEBI:90528) has role anti-inflammatory drug (CHEBI:35472) |
| VX-745 (CHEBI:90528) has role apoptosis inducer (CHEBI:68495) |
| VX-745 (CHEBI:90528) has role EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor (CHEBI:79091) |
| VX-745 (CHEBI:90528) is a aryl sulfide (CHEBI:35683) |
| VX-745 (CHEBI:90528) is a dichlorobenzene (CHEBI:23697) |
| VX-745 (CHEBI:90528) is a difluorobenzene (CHEBI:38582) |
| VX-745 (CHEBI:90528) is a pyrimidopyridazine (CHEBI:90614) |
| IUPAC Name |
|---|
| 5-(2,6-dichlorophenyl)-2-[(2,4-difluorophenyl)sulfanyl]-6H-pyrimido[1,6-b]pyridazin-6-one |
| Synonyms | Source |
|---|---|
| VX 745 | ChemIDplus |
| VX745 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10294643 | Reaxys |
| CAS:209410-46-8 | ChemIDplus |
| Citations |
|---|